Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-[2-(디에틸아미노)에톡시]벤조페논
4-[2-(디에틸아미노)에톡시]벤조페논 · Clomiphene Impurity 2 · Clomiphene benzophenone analog · Enclomiphene Impurity 1 · Clomifene EP Impurity B · Chloridazon Impurity 3 · Clomifene Citrate Impurity B · Clomifene Citrate EP Impurity B
![4-[2-(디에틸아미노)에톡시]벤조페논 분자 구조식](/img/chemical/69931.png)
식별자 및 물리적 특성
| CAS No. | 796-77-0 |
|---|---|
| 분자식 | C19H23NO2 |
| 평균 분자량 | 297.4 g/mol |
| 단동위원소 질량 | 297.17287898 g/mol |
| SMILES | CCN(CC)CCOc1ccc(C(=O)c2ccccc2)cc1 |
| InChIKey | GSTOOYJSPRJGDO-UHFFFAOYSA-N |
| PubChem CID | 69931 |
| EC No. | 212-348-2 |
| DTXSID | DTXSID80229792 |
| 현지명 | 4-[2-(디에틸아미노)에톡시]벤조페논 |
화학 및 물리적 성질
| XLogP | 4 |
|---|---|
| 극성 표면적 | 29.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 313 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 끓는 점 | 230 °C(Press: 3 Torr) |
| 밀도 | 1.057±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(가용성), 디클로로메탄(약간 용해됨), 메탄올(소량으로 용해) |
| pKa(산도 계수) | 9.50±0.25(Predicted) |
| 물리적 상태 | 기름 |
| 색상 | 연한 노란색에서 주황색까지 |
화학적 성질
Orange Oil
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 100% (2 of 2) of all reports.Not ClassifiedAggregated GHS information provided per 2 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | REACH registered substance: 4-[2-(diethylamino)ethoxy]benzophenone (EC: 212-348-2) |
| Hazard Classes and Categories | Not Classified |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
4-[2-(diethylamino)ethoxy]benzophenone is used in the preparation of antifertility agents.