Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
레보글루코세논
레보글루코세논 · (1S,5R)- · Ccris 4274 · Brn 4859778 · Levoglucosenone · Levoglucosenone>Levoglucosenone min. 98% · Levoglucosenone, 10 mM in DMSO · 6,8-DIOXA-BICYCLO[3.2.1]OCT-2-EN-4-ONE
식별자 및 물리적 특성
| CAS No. | 37112-31-5 |
|---|---|
| 분자식 | C6H6O3 |
| 평균 분자량 | 126.11 g/mol |
| SMILES | O=C1C=C[C@H]2CO[C@@H]1O2 |
| InChIKey | HITOXZPZGPXYHY-UJURSFKZSA-N |
| PubChem CID | 699486 |
| ChEMBL | CHEMBL4126941 |
| ChEBI | CHEBI:30999 |
| EC No. | 640-811-2 |
| 현지명 | 레보글루코세논 |
화학 및 물리적 성질
| XLogP | -0.2 |
|---|---|
| 극성 표면적 | 35.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 173 |
| 끓는 점 | 113°C/3mmHg(lit.) |
| 밀도 | 1.329±0.06 g/cm3(Predicted) |
| 굴절률 | nD25 1.5084 |
| 저장 조건 | Amber Vial, -20°C Freezer, Under Inert Atmosphere |
| 용해도 | 클로로포름(난용성), DMSO (약간 용해됨), 에틸아세테이트 (약간 용해됨) |
| 물리적 상태 | 액체 |
| 색상 | 무색~황색 |
| Merck | 14,5465 |
| 안정성 | 감광성 |
| InChI | InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1 |
| InChIKey | HITOXZPZGPXYHY-UJURSFKZSA-N |
| SMILES | [C@@]12([H])O[C@@]([H])(OC1)C(=O)C=C2 |
| LogP(분배 계수) | -0.740 (est) |
화학적 성질
Colourless to Yellow Oil
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | 6,8-Dioxabicyclo3.2.1oct-2-en-4-one, (1S,5R)-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| RTECS 번호 | JG7020000 |
| 관세 코드 | 2932990090 |
| 위험 문구(R) | 36 |
| 안전 문구(S) | 26 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
(-)-Form Levoglucosenone is a pyrolysis product of cellulose and cellulose-containing materials including pulp and paper waste products. Known as a pyrolytic product of cellulose, its very useful as a chiral source for synthesizing natural products.