Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Bromobenzyl bromide
m-Bromobenzyl · 3-BromobenzyL · α,3-dibromotoluene · à,3-dibromotoluene · 3-Bromoben bromide · 3-BroMobenl broMide · 3-Brombenzyl bromide · 3-Bromobenzyl bromid
식별자 및 물리적 특성
| CAS No. | 823-78-9 |
|---|---|
| 분자식 | C7H6Br2 |
| 평균 분자량 | 249.93 g/mol |
| 단동위원소 질량 | 247.88362439 g/mol |
| SMILES | BrCc1cccc(Br)c1 |
| InChIKey | ZPCJPJQUVRIILS-UHFFFAOYSA-N |
| PubChem CID | 69979 |
| EC No. | 212-519-1 |
| DTXSID | DTXSID4061175 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 39-41 °C(lit.) |
| 끓는 점 | 130 °C12 mm Hg |
| 밀도 | 1,56 g/cm3 |
| 굴절률 | 1.6066 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,2-8°C |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| 물리적 상태 | 결정 또는 결정성 분말 부착 |
| 색상 | 하얀색 |
| 용해도 | 물에 불용성. |
| BRN | 2078683 |
| InChI | InChI=1S/C7H6Br2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2 |
| InChIKey | ZPCJPJQUVRIILS-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(CBr)=C1 |
| EPA | Benzene, 1-bromo-3-(bromomethyl)- (823-78-9) |
화학적 성질
White to yellow solid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | 3-Bromobenzyl bromide: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29036990 |
| 위험 문구(R) | 34-37 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-25 |
| 포장분류 | III |
| 위험 등급 | 8Skin Corr. 1B |
| F 고인화성물질 | 19 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
3-Bromobenzyl bromide was used in the synthesis of, 1,7-di(3-bromobenzyl)cyclen and substituted 8-arylquinoline, phosphodiesterase 4 (PDE4) inhibitors.
일반 설명
3-Bromobenzyl bromide undergoes reduction with diethylzinc in the presence of Pd(PPh3)4 to yield corresponding hydrocarbon.