Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-플루오로페닐히드라진
4-플루오로페닐히드라진 · AKOS BBS-00006439 · 4-Fluorophenylhydrazin · 4-Fluorophenylhydrazine · N-(4-Fluorophenyl)hydrazine · 1-(4-FLUOROPHENYL)HYDRAZINE · Hydrazine, (4-fluorophenyl)- · (4-Fluorophenyl)hydrazine - [F89850]
식별자 및 물리적 특성
| CAS No. | 371-14-2 |
|---|---|
| 분자식 | C6H7FN2 |
| 평균 분자량 | 126.13 g/mol |
| 단동위원소 질량 | 126.05932644 g/mol |
| SMILES | NNc1ccc(F)cc1 |
| InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N |
| PubChem CID | 69982 |
| ChEMBL | CHEMBL3884307 |
| EC No. | 206-732-9 |
| DTXSID | DTXSID30190589 |
| 현지명 | 4-플루오로페닐히드라진 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 38.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 79.1 |
| SpringerMaterials Properties | 15N nuclear magnetic resonance spectrum |
| 녹는점 | 36.8 °C |
| 끓는 점 | 227℃ |
| 밀도 | 1.257 |
| 인화점 | 91℃ |
| 저장 조건 | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| pKa(산도 계수) | 5.24±0.20(Predicted) |
| InChI | InChI=1S/C6H7FN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| InChIKey | ZXBMIRYQUFQQNX-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(F)C=C1)N |
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P330, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Danger |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
4-Fluorophenylhydrazine is a versatile reactant used in various syntheses such as domino synthesis of indoles by zinc-promoted hydrohydrazination of terminal alkynes.