펜타플로로벤젠슬포닐클로라이드
펜타플로로벤젠슬포닐클로라이드 · 펜타플루오로벤젠설폰일 클로라이드 · Pentafluoro-1-benzenesulfonyl Chloride · 2,3,4,5,6-PENTAFLUOROBENZENESULFONYL CHLORIDE · AC 14711 · NSC96998 · NSC 96998 · 76720_FLUKA
식별자 및 물리적 특성
| CAS No. | 832-53-1 |
|---|---|
| 분자식 | C6ClF5O2S |
| 평균 분자량 | 266.57 g/mol |
| 단동위원소 질량 | 265.92276902 g/mol |
| SMILES | O=S(=O)(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChIKey | UOJCTEGNHXRPKO-UHFFFAOYSA-N |
| PubChem CID | 70026 |
| EC No. | 212-620-0 |
| DTXSID | DTXSID50232213 |
| 현지명 | 펜타플로로벤젠슬포닐클로라이드 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 315 |
| SpringerMaterials Properties | Schoenflies notation |
| 끓는 점 | 210-211 °C(lit.) |
| 밀도 | 1.796 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.479(lit.) |
| 인화점 | 195 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 비중 | 1.797 |
| 용해도 | 물에 용해됩니다(느리게 반응함). |
| BRN | 2142325 |
| InChI | InChI=1S/C6ClF5O2S/c7-15(13,14)6-4(11)2(9)1(8)3(10)5(6)12 |
| InChIKey | UOJCTEGNHXRPKO-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=C(F)C(F)=C(F)C(F)=C1F |
화학적 성질
clear colourless to light yellow liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 8/PG 2 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 34-37 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-24/25 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 21 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Pentafluorobenzenesulfonyl chloride is used as derivatizing reagent for simultaneous determination of fluoxetine and p-trifluoromethylphenol, an O-dealkylated metabolite of fluoxetine in human liver microsomes. It is also used for electrophore labeling of small tyrosyl peptides for their analysis by gas chromatography with electron-capture detection. It is also employed as derivatizing reagent for amphetamine in determination of amphetamine in human plasma samples using gas chromatography with electron-capture detection.
일반 설명
Pentafluorobenzenesulfonyl chloride reacts with benzene and thiophene derivatives in the presence of a ruthenium (II) catalyst to form corresponding perfluorophenylated compounds.