Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-메톡시-3-니트로벤잘데하이드
4-메톡시-3-니트로벤잘데하이드 · 3-Nitro-4-Methoxy-Benzaldehyde · AURORA 2012 · ASISCHEM R40024 · AKOS BBS-00004797 · 3-NITROANISALDEHYDE · TIMTEC-BB SBB002341 · 3-NITRO-4-ANISALDEHYDE
식별자 및 물리적 특성
| CAS No. | 31680-08-7 |
|---|---|
| 분자식 | C8H7NO4 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.0375077 g/mol |
| SMILES | COc1ccc(C=O)cc1[N+](=O)[O-] |
| InChIKey | YTCRQCGRYCKYNO-UHFFFAOYSA-N |
| PubChem CID | 700608 |
| EC No. | 678-312-7 |
| DTXSID | DTXSID50351453 |
| 현지명 | 4-메톡시-3-니트로벤잘데하이드 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 72.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 201 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 97-100 °C(lit.) |
| 끓는 점 | 334.8±27.0 °C(Predicted) |
| 밀도 | 1.322±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | powder to crystal |
| 색상 | Light orange to Yellow to Green |
| InChI | InChI=1S/C8H7NO4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-5H,1H3 |
| InChIKey | YTCRQCGRYCKYNO-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(OC)C([N+]([O-])=O)=C1 |
화학적 성질
Yellow needle crystal
안전 및 규제
| GHS 분류 | WarningH302 (16.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (16.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 38220090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |