Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디카플루오로벤조페논
디카플루오로벤조페논 · Perfluorobenzophenone 98% · PERFLUOROBENZOPHENONE · Decafluorobenzophenone · Benzophenone, decafluoro- · Decafluorobenzophenone98% · Decafluorobenzophenone >Decafluorobenzophenone 98% · bis(perfluorophenyl)methanone
식별자 및 물리적 특성
| CAS No. | 853-39-4 |
|---|---|
| 분자식 | C13F10O |
| 평균 분자량 | 362.12 g/mol |
| 단동위원소 질량 | 361.97894682 g/mol |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChIKey | WWQLXRAKBJVNCC-UHFFFAOYSA-N |
| PubChem CID | 70068 |
| ChEMBL | CHEMBL2001102 |
| EC No. | 212-717-8 |
| DTXSID | DTXSID60234501 |
| 현지명 | 디카플루오로벤조페논 |
화학 및 물리적 성질
| XLogP | 4.3 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 11 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 24 |
| 형식 전하 | 0 |
| 복잡도 | 406 |
| PFAS | PFAS -> Other/unspecified |
| SpringerMaterials Properties | Fluorescence |
| 녹는점 | 90-95 °C(lit.) |
| 끓는 점 | 206 |
| 밀도 | 1.6684 (estimate) |
| 저장 조건 | Store at 0-8 °C |
| 물리적 상태 | powder to crystaline |
| 색상 | 흰색에서 밝은 노란색 |
| 용해도 | 메탄올에 용해됩니다. 물에 불용성. |
| BRN | 2066476 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C13F10O/c14-3-1(4(15)8(19)11(22)7(3)18)13(24)2-5(16)9(20)12(23)10(21)6(2)17 |
| InChIKey | WWQLXRAKBJVNCC-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(c(F)c1F)C(=O)c2c(F)c(F)c(F)c(F)c2F |
화학적 성질
solid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 60% (3 of 5) of all reports.WarningH315 (40%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (40%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26-24/25 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Perfluorobenzophenone was used in the synthesis of fluorinated acridones and acridines. Fluorinated polyetherketones prepared from decafluorobenzophenone. Laser pulse excitation of decafluorobenzophenone (DFB) in acetonitrile yields the triplet 3DFB.