Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(클로로메틸)벤조일 클로라이드
4-(클로로메틸)벤조일클로라이드 · 4-(클로로메틸)벤조일 클로라이드 · CMBC · SKL1281 · Butafenacil Impurity 4 · α-Chloro-p-toluoyl chloride · ChloroMethyl)benzoylchlorid · 4-CHLOROMETHYLBENZOYL CHLORIDE
식별자 및 물리적 특성
| CAS No. | 876-08-4 |
|---|---|
| 분자식 | C8H6Cl2O |
| 평균 분자량 | 189.04 g/mol |
| 단동위원소 질량 | 187.97957017 g/mol |
| SMILES | O=C(Cl)c1ccc(CCl)cc1 |
| InChIKey | RCOVTJVRTZGSBP-UHFFFAOYSA-N |
| PubChem CID | 70136 |
| EC No. | 212-881-0 |
| DTXSID | DTXSID20236501 |
| 현지명 | 4-(클로로메틸)벤조일 클로라이드 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 139 |
| SpringerMaterials Properties | Boiling point |
| 녹는점 | 30-32 °C(lit.) |
| 끓는 점 | 126-128 °C6 mm Hg(lit.) |
| 밀도 | 1.2979 (rough estimate) |
| 굴절률 | 1.5605 (estimate) |
| 인화점 | 199 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 톨루엔에 용해됨 |
| 물리적 상태 | 저융점 결정질 덩어리 |
| 색상 | 흰색~밝은 베이지 |
| InChI | InChI=1S/C8H6Cl2O/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4H,5H2 |
| InChIKey | RCOVTJVRTZGSBP-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(CCl)C=C1 |
화학적 성질
white to light beige low melting crystalline mass
안전 및 규제
| GHS 분류 | DangerH290 (19.2%): May be corrosive to metals [Warning Corrosive to Metals]P234, P260, P261, P264, P270, P271, P280, P301+P317, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P330, P363, P390, P403+P233, P405, P406, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 18-03-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/33414 |
| Hazard Classes and Categories | Met. Corr. 1 (19.2%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3261 |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 34-36/37 |
| 위험 표시 | C |
| 안전 문구(S) | 23-26-27-36/37/39-45-25 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1BSTOT SE 3 |
| 기존화학 물질 | 2003-3-2413 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
4-(Chloromethyl)benzoyl Chloride is used in the synthetic preparation of various compounds and pharmaceuticals. 4-(Chloromethyl)benzoyl Chloride was used in the synthesis of several imidazo[2,1-b]thia zoles.