Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸글리옥살레이트
에틸글리옥살레이트 · Ethyl 2-oxoacetate · ETHYL GLYOXYLATE · Oxoacetic acid ethyl ester · ETHYL OXOACETATE · GLYOXYLIC ACID ETHYL ESTER · Ethyl glyoxylate, 50% solution in toluene · 2-Oxoacetic acid ethyl ester
식별자 및 물리적 특성
| CAS No. | 924-44-7 |
|---|---|
| 분자식 | C4H6O3 |
| 평균 분자량 | 102.09 g/mol |
| 단동위원소 질량 | 102.03169405 g/mol |
| SMILES | CCOC(=O)C=O |
| InChIKey | DBPFRRFGLYGEJI-UHFFFAOYSA-N |
| PubChem CID | 70211 |
| ChEBI | CHEBI:53275 |
| EC No. | 213-105-3 |
| DTXSID | DTXSID6061282 |
| 현지명 | 에틸글리옥살레이트 |
화학 및 물리적 성질
| XLogP | 0.4 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 77 |
| 끓는 점 | 110°C |
| 밀도 | 1.03 g/mL at 20 °C |
| 굴절률 | 1.4750 |
| 인화점 | 7°C |
| 저장 조건 | Refrigerator |
| 용해도 | 클로로포름, 에틸아세테이트에 용해됨 |
| 물리적 상태 | 기름 |
| 색상 | 무색의 |
| 용해도 | 물과 섞이지 않습니다. |
| BRN | 1209486 |
| InChI | InChI=1S/C4H6O3/c1-2-7-4(6)3-5/h3H,2H2,1H3 |
| InChIKey | DBPFRRFGLYGEJI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C=O |
| EPA | Acetic acid, oxo-, ethyl ester (924-44-7) |
화학적 성질
Clear colorless to slightly yellow solution
안전 및 규제
| GHS 분류 | DangerH225 (75%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P271, P272, P280, P301+P316, P302+P352, P303+P361+P353, P304+P340, P319, P321, P331, P332+P317, P333+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 12 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 22-06-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/18142 |
| Hazard Classes and Categories | Flam. Liq. 2 (75%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 1294 3/PG 2 |
| 관세 코드 | 29183000 |
| 위험 문구(R) | 11-38-43-48/20-63-65-67 |
| 위험 표시 | F,Xn |
| 안전 문구(S) | 36/37-62-16 |
| 포장분류 | II |
| 위험 등급 | 3 |
| 기존화학 물질 | KE-27559 |
용도
용도
Ethyl glyoxylate is widely used as an intermediate in the synthesis of pharmaceuticals (high reactivity of aldehyde function). It is used in the synthesis of a biodegradable polymer, poly(ethyl glyoxylate). It is actively involved in the Friedel-Crafts alkylation reactions with thiophenes to give the corresponding secondary alcohols.