Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-메틸말레이미드
N-메틸말레이미드 · 1-METHYL-1H-PYRROLE-2,5-DIONE · N-METHYLMALEIMID · N-Methylmaleinimide · N-Methyl-Malemide · N-METHYLMALEIMIDE · Maleimide,N-methyl- · Maleimide, N-methyl-
식별자 및 물리적 특성
| CAS No. | 930-88-1 |
|---|---|
| 분자식 | C5H5NO2 |
| 평균 분자량 | 111.1 g/mol |
| 단동위원소 질량 | 111.0320284 g/mol |
| SMILES | CN1C(=O)C=CC1=O |
| InChIKey | SEEYREPSKCQBBF-UHFFFAOYSA-N |
| PubChem CID | 70261 |
| ChEMBL | CHEMBL225037 |
| ChEBI | CHEBI:232160 |
| EC No. | 213-226-1 |
| DTXSID | DTXSID30239240 |
| 현지명 | N-메틸말레이미드 |
화학 및 물리적 성질
| XLogP | -0.5 |
|---|---|
| 극성 표면적 | 37.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 153 |
| Kovats Retention Index | 925.1 |
| 녹는점 | 94-96 °C (lit.) |
| 끓는 점 | 208.19°C (rough estimate) |
| 밀도 | 1.3113 (rough estimate) |
| 굴절률 | 1.4260 (estimate) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| pKa(산도 계수) | -2.18±0.20(Predicted) |
| 물리적 상태 | 크리스탈 |
| 색상 | 연노랑 |
| 용해도 | 물에 약간 용해됩니다. |
| BRN | 108550 |
| InChI | InChI=1S/C5H5NO2/c1-6-4(7)2-3-5(6)8/h2-3H,1H3 |
| InChIKey | SEEYREPSKCQBBF-UHFFFAOYSA-N |
| SMILES | N1(C)C(=O)C=CC1=O |
| NIST | N-Methylmaleimide(930-88-1) |
화학적 성질
light yellow crystals
안전 및 규제
| GHS 분류 | DangerH302 (92.5%): Harmful if swallowed [Warning Acute toxicity, oral]H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]H317 (100%): May cause an allergic skin reaction [Warning Sensitization, Skin]P260, P261, P264, P270, P272, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P333+P317, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 53 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. For more detailed information, please visit ECHA C&L website. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (92.5%)Skin Corr. 1C (100%)Skin Sens. 1 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | ON5600000 |
| 운송 번호(UN) | UN 1759 8/PG 2 |
| 관세 코드 | 29241990 |
| 위험 문구(R) | 22-34-43-25-20/21 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 6.1Acute Tox. 4 OralSkin Corr. 1BSkin Sens. 1 |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
N-Methylmaleimide is an electron deficient olefin that acts as a thiol-blocking reagent.