Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-니트로-4-사이멘
2-니트로-4-사이멘 · NSC 9839 · 2-NITRO-P-CYMENE · 2-Nitro-4-cymene · 2-Nitro-para-cymene · 2-Nitro-p-cymene>2-Nitro-4-cymene,95% · 2-Nitro-4-cymene,90%,tech. · 4-Isopropyl-2-nitrotoluene
식별자 및 물리적 특성
| CAS No. | 943-15-7 |
|---|---|
| 분자식 | C10H13NO2 |
| 평균 분자량 | 179.22 g/mol |
| 단동위원소 질량 | 179.09462866 g/mol |
| SMILES | Cc1ccc(C(C)C)cc1[N+](=O)[O-] |
| InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N |
| PubChem CID | 70340 |
| EC No. | 213-397-2 |
| DTXSID | DTXSID9061336 |
| 현지명 | 2-니트로-4-사이멘 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 186 |
| SpringerMaterials Properties | Boiling point |
| 녹는점 | 1°C (estimate) |
| 끓는 점 | 134 °C / 15mmHg |
| 밀도 | 1.07 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.528(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| 색상 | Light yellow to Yellow to Orange |
| InChI | 1S/C10H13NO2/c1-7(2)9-5-4-8(3)10(6-9)11(12)13/h4-7H,1-3H3 |
| InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C)c(c1)[N+]([O-])=O |
| EPA | Benzene, 1-methyl-4-(1-methylethyl)-2-nitro- (943-15-7) |
화학적 성질
clear orange liquid
안전 및 규제
| GHS 분류 | WarningH302 (97.6%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (97.6%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2904200090 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37/39-26 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-Nitro-p-cymene was used in the synthesis of 5 -isopropyl-8-methylquinoline. It was used as mediator solvent in perchlorate ion-selective electrode with poly(vinyl chloride) matrix membrane on conductive silver-epoxy composite.
일반 설명
Reduction products of 2-nitro-p-cymene are significant dye intermediates.