Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,4,5-트리메톡시페닐아세트산
3,4,5-트라이메톡시페닐아세트산 · 3,4,5-트리메톡시페닐아세트산 · 3,4,5-TrimethoxyphenyL · TIMTEC-BB SBB003317 · RARECHEM AL BO 0126 · LABOTEST-BB LT00454740 · Laudanosine intermediate · TriMethoxyphenylaceticaci
식별자 및 물리적 특성
| CAS No. | 951-82-6 |
|---|---|
| 분자식 | C11H14O5 |
| 평균 분자량 | 226.23 g/mol |
| 단동위원소 질량 | 226.08412355 g/mol |
| SMILES | COc1cc(CC(=O)O)cc(OC)c1OC |
| InChIKey | DDSJXCGGOXKGSJ-UHFFFAOYSA-N |
| PubChem CID | 70372 |
| ChEMBL | CHEMBL4438899 |
| ChEBI | CHEBI:125676 |
| EC No. | 213-456-2 |
| DTXSID | DTXSID60241755 |
| 현지명 | 3,4,5-트리메톡시페닐아세트산 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 65 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 216 |
| 물질 분류 | Other Classes -> Organic Acids |
| Physical Description | Beige crystalline solid[Sigma-Aldrich MSDS] |
| 녹는점 | 117-120 °C (lit.) |
| 끓는 점 | 327.83°C (rough estimate) |
| 밀도 | 1.2668 (rough estimate) |
| 굴절률 | 1.5140 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 4.23±0.10(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 크림색으로 |
| 용해도 | 녹는 |
| BRN | 2697844 |
| InChI | InChI=1S/C11H14O5/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13) |
| InChIKey | DDSJXCGGOXKGSJ-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC(OC)=C(OC)C(OC)=C1 |
| NIST | 3,4,5-Trimethoxyphenylacetic acid(951-82-6) |
화학적 성질
white to cream-colored crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzeneacetic acid, 3,4,5-trimethoxy-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A skin irritant[Sigma-Aldrich MSDS] See 3-Methoxyphenylacetic acid and 2-Methoxyphenylacetic acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29189090 |
| 위험 문구(R) | 38-36/37/38-22 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-37/39-26 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,4,5-Trimethoxyphenylacetic Acid is a reagent in the preparation of 3-phenylcoumarins as antidepressant agents.