Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-히드록시-5-메틸피리딘
2-히드록시-5-메틸피리딘 · 5-메틸-2-피리돈 · 5-Methylpyridin-2(1H)-one · 2(1H)-Pyridinone, 5-methyl- · 5-methyl-2-pyridone · AKOS BBS-00002970 · 2-HYDROXY-5-PICOLINE · 5-METHYL-2-PYRIDINOL
식별자 및 물리적 특성
| CAS No. | 1003-68-5 |
|---|---|
| 분자식 | C6H7NO |
| 평균 분자량 | 109.13 g/mol |
| 단동위원소 질량 | 109.05276384 g/mol |
| SMILES | Cc1ccc(=O)[nH]c1 |
| InChIKey | SOHMZGMHXUQHGE-UHFFFAOYSA-N |
| PubChem CID | 70482 |
| ChEBI | CHEBI:194862 |
| EC No. | 213-713-9 |
| DTXSID | DTXSID20143120 |
| 현지명 | 2-히드록시-5-메틸피리딘 |
화학 및 물리적 성질
| XLogP | 0.1 |
|---|---|
| 극성 표면적 | 29.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| 녹는점 | 183-187 °C (lit.) |
| 끓는 점 | 304.2±15.0 °C(Predicted) |
| 밀도 | 1.053±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 에탄올(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 12.43±0.10(Predicted) |
| 색상 | 연한 노란색에서 밝은 노란색까지 |
| BRN | 107074 |
| InChI | InChI=1S/C6H7NO/c1-5-2-3-6(8)7-4-5/h2-4H,1H3,(H,7,8) |
| InChIKey | SOHMZGMHXUQHGE-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(C)C=C1 |
| NIST | 2(1H)-pyridinone, 5-methyl-(1003-68-5) |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 8% (4 of 50) of reports.DangerH302 (80%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 27-02-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/18172 |
| Hazard Classes and Categories | Acute Tox. 4 (80%)Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 22-37/38-41-36/37/39 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36-37 |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Hydroxy-5-methylpyridine (cas# 1003-68-5) is a useful compound for organic synthesis. In particular it has been used for the diastereoselective preparation of cyclobutane-fused pyridinyl sulfonyl fluorides. 2-hydroxy-5-methylpyridine and Iodobenzene were the impurities present in Pirfenidone (PFD) drug substance. PFD is a novel antifibrotic agent approved for mild to moderate Idiopathic pulmonary fibrosis (IPF) as orphan drug[1].