N-아세틸트립타민
N-아세틸트립타민 · Acetotryptamide · N-ACETYLTRYPTAMINE · Nb-Acetyltryptamine · N-(2-(1H-Indol-3-yl) · N10-Acetyltryptamine · Acetyltryptamine, N- · TRYPTAMINE, N-ACETYL-
식별자 및 물리적 특성
| CAS No. | 1016-47-3 |
|---|---|
| 분자식 | C12H14N2O |
| 평균 분자량 | 202.25 g/mol |
| 단동위원소 질량 | 202.11061307 g/mol |
| SMILES | CC(=O)NCCc1c[nH]c2ccccc12 |
| InChIKey | NVUGEQAEQJTCIX-UHFFFAOYSA-N |
| PubChem CID | 70547 |
| ChEMBL | CHEMBL33171 |
| ChEBI | CHEBI:55515 |
| DTXSID | DTXSID30144042 |
| 현지명 | N-아세틸트립타민 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 44.9 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 230 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 1.41 |
| 녹는점 | 74.0 to 78.0 °C |
| 끓는 점 | 200°C/0.2mmHg(lit.) |
| 밀도 | 1.164±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 알코올: 용해 가능 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 16.48±0.46(Predicted) |
| 색상 | White to Light yellow to Light orange |
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 2933.99.8290 |
| 안전 문구(S) | 22-24/25 |
용도
개요
N-acetyl Tryptamine is a structural analog of melatonin (5-methoxy-N-acetyltryptamine; ) that binds the melatonin MT2 receptor (Ki = 41 nM). It acts as a melatonin receptor antagonist in frog skin and chicken retina and as a partial agonist in rabbit retina. N-acetyl Tryptamine is also a reaction product of assays for serotonin N-acetyltransferase, the penultimate enzyme in the melatonin biosynthetic pathway.
용도
N-acetyl Tryptamine is a structural analog of melatonin (5-methoxy-N-acetyltryptamine; ) that binds the melatonin MT2 receptor (Ki = 41 nM). It acts as a melatonin receptor antagonist in frog skin and chicken retina and as a partial agonist in rabbit retina. N-acetyl Tryptamine is also a reaction product of assays for serotonin N-acetyltransferase, the penultimate enzyme in the melatonin biosynthetic pathway.