Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
벤질트리페닐포스포늄 클로라이드
벤질트리페닐포스포늄클로라이드 · 트리페닐(페닐메틸)포스포늄염화물 · BPP · BTPPC · (phenylmethyl)triphenyl-phosphoniuchloride · BTPPCl · NSC 116712 · AURORA KA-1173
식별자 및 물리적 특성
| CAS No. | 1100-88-5 |
|---|---|
| 분자식 | C25H22ClP |
| 평균 분자량 | 388.9 g/mol |
| 단동위원소 질량 | 388.1147654 g/mol |
| SMILES | [Cl-].c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChIKey | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| PubChem CID | 70671 |
| ChEMBL | CHEMBL3561634 |
| EC No. | 214-154-3 |
| DTXSID | DTXSID6051566 |
| 현지명 | 벤질트리페닐포스포늄 클로라이드 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 27 |
| 형식 전하 | 0 |
| 복잡도 | 347 |
| 녹는점 | ≥300 °C (lit.) |
| 밀도 | 1.18 g/cm3 (20℃) |
| 증기압 | 0.1 hPa |
| 인화점 | 300°C |
| 저장 조건 | Store at <= 20°C. |
| 물리적 상태 | 결정성 분말 |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 녹는 |
| BRN | 3599868 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C25H22P.ClH/c1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H21H/q+1/p-1 |
| InChIKey | USFRYJRPHFMVBZ-UHFFFAOYSA-M |
| SMILES | [Cl-].C(c1ccccc1)[P+](c2ccccc2)(c3ccccc3)c4ccccc4 |
| LogP(분배 계수) | -0.7 at 20℃ |
| EPA | Phosphonium, triphenyl(phenylmethyl)-, chloride (1100-88-5) |
화학적 성질
Benzyltriphenylphosphonium Chloride is a white to off white powder, It is highly soluble in water and polarizable solvents. It is a quaternary phosphonium salt mainly used in organic synthesis as a wittig reagent and as a phase transfer catalyst in the production of fluoroelastomers and printing inks.
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | TA2416500 |
| 운송 번호(UN) | UN 2811 6.1/PG 2 |
| 독성 | LD50 orally in Rabbit: 43 mg/kg |
| 관세 코드 | 29310095 |
| 위험 문구(R) | 25-36/37/38-24/25 |
| 위험 표시 | T,Xi |
| 안전 문구(S) | 26-36/37/39-45-36 |
| 포장분류 | II |
| 위험 등급 | 6.1Acute Tox. 2 InhalationAcute Tox. 2 OralAquatic Acute 1Aquatic Chronic 1Eye Dam. 1STOT RE 1STOT SE 3 |
| 기존화학 물질 | KE-34738 |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
Benzyltriphenylphosphonium Chloride was used as a reagent in the organic synthesis of several compounds including that of stabilised phosphonium ylides containing saturated oxygen heterocycles. Also used in the synthesis of novel substituted cis-stilbene derivatives which display antimicrobial activity.