Bromopyruvic Acid
BROMOPYRUVIC ACID · 3-BROMO-2-OXOPROPANOIC ACID · 3-bromopyruvate · 3-BROMOPYRUVIC ACID · bromopyruvate · 3-BROMO-2-OXOPROPIONIC ACID · 2-Oxo-3-bromopropanoic acid · beta-bromopyruvicacid
식별자 및 물리적 특성
| CAS No. | 1113-59-3 |
|---|---|
| 분자식 | C3H3BrO3 |
| 평균 분자량 | 166.96 g/mol |
| 단동위원소 질량 | 165.92655606 g/mol |
| SMILES | O=C(O)C(=O)CBr |
| InChIKey | PRRZDZJYSJLDBS-UHFFFAOYSA-N |
| PubChem CID | 70684 |
| ChEMBL | CHEMBL177837 |
| ChEBI | CHEBI:131461 |
| EC No. | 214-206-5 |
| DTXSID | DTXSID7040940 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 54.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 98.4 |
| 녹는점 | 77-82 °C |
| 끓는 점 | 223.4±23.0 °C(Predicted) |
| 밀도 | 1.7314 (rough estimate) |
| 굴절률 | 1.4650 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 물: 용해성1g/10mL, 투명, 무색 |
| 물리적 상태 | 백색 결정성 고체 |
| pKa(산도 계수) | 1.84±0.54(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 물, 디메틸 설폭사이드, 에틸 아세테이트 및 물에 용해됩니다. |
| BRN | 1746786 |
| InChI | InChI=1S/C3H3BrO3/c4-1-2(5)3(6)7/h1H2,(H,6,7) |
| InChIKey | PRRZDZJYSJLDBS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(=O)CBr |
| EPA | Propanoic acid, 3-bromo-2-oxo- (1113-59-3) |
화학적 성질
Off-white solid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | UZ0840000 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29183000 |
| 위험 문구(R) | 34-20/21/22 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-27 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 19-21 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Bromopyruvic Acid is a synthetic brominated derivative of pyruvic acid. Bromopyruvic Acid maybe a potential treatment for certain types of cancer as it has shown to be effective at eliminating aggress ive liver tumors.
일반 설명
Bromopyruvic acid is an affinity label for cysteine residues. It acts as cross-linker between nucleic acids and proteins. Kinetics of inactivation of pancreatic ribonuclease A by bromopyruvic acid has been investigated.
제조 및 합성 방법
제조 방법
Synthesis method of 3-bromopyruvic acid: add a little concentrated sulfuric acid and solvent dichloromethane to pyruvic acid in a reaction flask, add bromine dropwise for about 3.5h and stir, a white precipitate is produced, then continue to stir for 1h, dilute with cyclohexane and petroleum ether, then cool the reaction mixture to get crystals, filter, wash with petroleum ether and dry to get the finished product of 3-bromopyruvic acid.