Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디클로로말레 무수물
디클로로말레무수물 · 디클로로말레산무수물 · 2,3-DICHLOROMALEIC ANHYDRIDE · Dichloromaleic acid anhydride · oromaL · DICHLOROMALEIC ANHYDRIDE · 3,4-dichloro-5-furandione · Maleic anhydride, dichloro-
식별자 및 물리적 특성
| CAS No. | 1122-17-4 |
|---|---|
| 분자식 | C4Cl2O3 |
| 평균 분자량 | 166.94 g/mol |
| 단동위원소 질량 | 165.92244922 g/mol |
| SMILES | O=C1OC(=O)C(Cl)=C1Cl |
| InChIKey | AGULWIQIYWWFBJ-UHFFFAOYSA-N |
| PubChem CID | 70728 |
| ChEMBL | CHEMBL2270558 |
| EC No. | 214-343-0 |
| DTXSID | DTXSID1061526 |
| 현지명 | 디클로로말레 무수물 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 196 |
| Polymers | Plastics & Rubber -> Acid Anhydrides, Cyclic |
| SpringerMaterials Properties | Schoenflies notation |
| Physical Description | Beige crystalline solid[Sigma-Aldrich MSDS] |
| 녹는점 | ~120 °C |
| 끓는 점 | 118-125 °C |
| 밀도 | 1.7168 (estimate) |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 클로로포름, 메탄올(약간 가열) 에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
| BRN | 121027 |
| InChI | InChI=1S/C4Cl2O3/c5-1-2(6)4(8)9-3(1)7 |
| InChIKey | AGULWIQIYWWFBJ-UHFFFAOYSA-N |
| SMILES | O1C(=O)C(Cl)=C(Cl)C1=O |
| NIST | 2,5-Furandione, 3,4-dichloro-(1122-17-4) |
| EPA | Dichloromaleic anhydride (1122-17-4) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 2,5-Furandione, 3,4-dichloro-2,5-Furandione, 3,4-dichloro-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] See Chloromaleic anhydride. |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 유해 작용 | Asthma - Reversible bronchoconstriction (narrowing of bronchioles) initiated by the inhalation of irritating or allergenic agents. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2932190090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANT |
| 기존화학 물질 | KE-10147 |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Dichloromaleic Anhydride is a derivative of Maleic Anhydride (M124400) found to have considerable antifungal activity against Botrytis cinerea.