Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-클로로페노티아진
2-클로로페노티아진 · 2-chloro-10H-Phenothiazine · Chlorophenothiazine · Chlorpromazine impurity E CRS · NSC 17469 · NSC 67188 · NSC 170953 · orophenothiazine
식별자 및 물리적 특성
| CAS No. | 92-39-7 |
|---|---|
| 분자식 | C12H8ClNS |
| 평균 분자량 | 233.72 g/mol |
| 단동위원소 질량 | 233.00659794 g/mol |
| SMILES | Clc1ccc2c(c1)Nc1ccccc1S2 |
| InChIKey | KFZGLJSYQXZIGP-UHFFFAOYSA-N |
| PubChem CID | 7088 |
| ChEMBL | CHEMBL1411769 |
| EC No. | 202-152-5 |
| DTXSID | DTXSID3057854 |
| 현지명 | 2-클로로페노티아진 |
화학 및 물리적 성질
| XLogP | 4.8 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 236 |
| 녹는점 | 195-200 °C (lit.) |
| 끓는 점 | 395.7±31.0 °C(Predicted) |
| 밀도 | 1.2350 (rough estimate) |
| 굴절률 | 1.6100 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 초음파처리) |
| pKa(산도 계수) | -2.28±0.20(Predicted) |
| 물리적 상태 | crystals |
| 색상 | 페일베이지부터 베이지까지 |
| BRN | 176587 |
| InChI | InChI=1S/C12H8ClNS/c13-8-5-6-12-10(7-8)14-9-3-1-2-4-11(9)15-12/h1-7,14H |
| InChIKey | KFZGLJSYQXZIGP-UHFFFAOYSA-N |
| SMILES | C1=C2C(SC3=C(N2)C=CC=C3)=CC=C1Cl |
| LogP(분배 계수) | 3.28 |
| EPA | 10H-Phenothiazine, 2-chloro- (92-39-7) |
화학적 성질
GREYISH TO SLIGHTLY GREEN OR BROWNISH POWDER
안전 및 규제
| GHS 분류 | WarningH315 (67.2%): Causes skin irritation [Warning Skin corrosion/irritation]P203, P261, P264, P264+P265, P271, P272, P273, P280, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P332+P317, P333+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 67 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 26-02-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/2066910H-Phenothiazine, 2-chloro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (67.2%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SN7580000 |
| 관세 코드 | 2934300000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | Skin Sens. 1 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Chlorophenothiazine may be used as starting reagent for the synthesis of N-(10H-phenothiazin-1-yl) benzene sulphonamide.
일반 설명
2-Chlorophenothiazine is an methylene blue (MB) derivative. Transient resonance Raman and absorption spectra of the lowest excited triplet states T1 and the cation radicals of 2-chlorophenothiazine have been investigated. Molecular semiconductors based on the 1:1 charge-transfer complexes of 2-chlorophenothiazine with 2,3-dichloro-5,6-dicyano-p-benzoquinone (DDQ) have been investigated by X-ray powder diffraction.