Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Trisiloxane, 1,1,3,3,5,5-hexamethyl-
Trisiloxane, 1,1,3,3,5,5-hexamethyl- · DK048 · DK489 · DKSI063 · DKFELEX0113 · Bis(dimethylsiloxy)d · HEXAMETHYLTRISILOXANE · 1,1,3,3,5,5-HexamethyL
식별자 및 물리적 특성
| CAS No. | 1189-93-1 |
|---|---|
| 분자식 | C6H20O2Si3 |
| 평균 분자량 | 208.482 g/mol |
| 단동위원소 질량 | 208.07710947 g/mol |
| SMILES | C[SiH](C)O[Si](C)(C)O[SiH](C)C |
| InChIKey | HZBDPZBVINJJET-UHFFFAOYSA-N |
| PubChem CID | 70921 |
| DTXSID | DTXSID10883664 |
화학 및 물리적 성질
| 녹는점 | -67°C |
|---|---|
| 끓는 점 | 128 °C |
| 밀도 | 0.83 |
| 굴절률 | 1.38 |
| 인화점 | 20 °C |
| 저장 조건 | Flammables area |
| 물리적 상태 | clear liquid |
| 색상 | Colorless to Almost colorless |
| 비중 | 0.822 |
| 용해도 | 물과 약간 섞임. |
| BRN | 1746341 |
| InChI | 1S/C6H20O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h9-10H,1-6H3 |
| InChIKey | HZBDPZBVINJJET-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)O[Si](C)(C)O[Si]([H])(C)C |
| EPA | Trisiloxane, 1,1,3,3,5,5-hexamethyl- (1189-93-1) |
화학적 성질
clear colorless liquid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 1993 3/PG 2 |
| 관세 코드 | 29319090 |
| 위험 문구(R) | 11 |
| 위험 표시 | F |
| 안전 문구(S) | 16-23-24/25 |
| 포장분류 | II |
| 위험 등급 | 3Flam. Liq. 2 |
| F 고인화성물질 | 10 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
1,1,3,3,5,5-Hexamethyltrisiloxane is involved in the preparation of 2-bis(3-allyl-4-hydroxyphenyl)hexafluoropropane, which is associated with inorganic siloxane polymer and used as a coating material for the detection of toxic chemical warfare agents. It is also used as a silylating agent and to prepare 1,5-Bis[2-(1,2-epoxycyclohex-4-yl)ethyl]-1,1,3,3,5,5-hexamethyltrisiloxane from 4-vinyl-1-cyclohexene-1,2-epoxide by hydrosilylation.