Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-나프탈렌술포닐클로라이드
2-나프탈렌술포닐클로라이드 · NAPHTHALENE-2-SULFONYL CHLORIDE · NAPHTHALENE-2-SULPHONYL CHLORIDE · ene-2-suL · AKOS B022434 · ART-CHEM-BB B022434 · 2-Naphthalenesulfony · b-Naphthalenesulfochloride
식별자 및 물리적 특성
| CAS No. | 93-11-8 |
|---|---|
| 분자식 | C10H7ClO2S |
| 평균 분자량 | 226.68 g/mol |
| 단동위원소 질량 | 225.98552814 g/mol |
| SMILES | O=S(=O)(Cl)c1ccc2ccccc2c1 |
| InChIKey | OPECTNGATDYLSS-UHFFFAOYSA-N |
| PubChem CID | 7125 |
| EC No. | 202-219-9 |
| DTXSID | DTXSID5059080 |
| 현지명 | 2-나프탈렌술포닐클로라이드 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 294 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| 녹는점 | 74-76 °C (lit.) |
| 끓는 점 | 147.7 °C/0.6 mmHg (lit.) |
| 밀도 | 1.3661 (estimate) |
| 증기압 | 0.004Pa at 25℃ |
| 인화점 | 200-202°C/13mm |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 톨루엔에 용해됨 |
| 물리적 상태 | 가루 |
| 색상 | 밝은 노란색에서 베이지색까지 |
| 용해도 | 불용성 |
| BRN | 641898 |
| InChI | 1S/C10H7ClO2S/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChIKey | OPECTNGATDYLSS-UHFFFAOYSA-N |
| SMILES | ClS(=O)(=O)c1ccc2ccccc2c1 |
| LogP(분배 계수) | 2.2 at 25℃ |
| NIST | 2-Naphthalenesulfonyl chloride(93-11-8) |
| EPA | 2-Naphthalenesulfonyl chloride (93-11-8) |
화학적 성질
LIGHT YELLOW TO BEIGE POWDER
안전 및 규제
| GHS 분류 | DangerH314 (80.3%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P273, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P332+P317, P362+P364, P363, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 66 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 20-03-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/208662-Naphthalenesulphonyl chloride: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1B (80.3%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049020 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-27 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Met. Corr. 1Skin Corr. 1B |
| F 고인화성물질 | 21 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
2-Naphthalenesulfonyl chloride was employed as capping reagent for primary amine to convert histamine to a selective histamine H3-receptor antagonist. It was used for pre-column derivatization during the high-performance liquid chromatographic assay of neomycin sulfate.