식별자 및 물리적 특성
| CAS No. | 727388-71-8 |
|---|
| 분자식 | C17H32N2OSn |
|---|
| 평균 분자량 | 399.2 g/mol |
|---|
| 단동위원소 질량 | 400.153666 g/mol |
|---|
| SMILES | CCC[CH2][Sn]([CH2]CCC)([CH2]CCC)[c]1ncc(OC)cn1 |
|---|
| InChIKey | UZWPLISEEGWAEA-UHFFFAOYSA-N |
|---|
| PubChem CID | 71270218 |
|---|
| EC No. | 878-117-9 |
|---|
| DTXSID | DTXSID701279205 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 35 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 11 |
|---|
| 무거운 원자 수 | 21 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 233 |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P264+P265, P270, P273, P280, P301+P316, P302+P352, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P391, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
