Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Aprindine Hydrochloride
APRINDINE HYDROCHLORIDE · ms-5075 · fiboran · aspenon · Fibocil · Amidonal · Aprindina · APRINDINE HCL
식별자 및 물리적 특성
| CAS No. | 33237-74-0 |
|---|---|
| 분자식 | C22H31ClN2 |
| 평균 분자량 | 358.9 g/mol |
| 단동위원소 질량 | 358.2175767 g/mol |
| SMILES | CCN(CC)CCCN(c1ccccc1)C1Cc2ccccc2C1.Cl |
| InChIKey | KIPFVRHNAAZJOD-UHFFFAOYSA-N |
| PubChem CID | 71413 |
| ChEMBL | CHEMBL2104501 |
| ChEBI | CHEBI:31229 |
| EC No. | 251-418-7 |
| DTXSID | DTXSID5046726 |
화학 및 물리적 성질
| 극성 표면적 | 6.5 |
|---|---|
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 332 |
| 녹는점 | 120-121° |
| 저장 조건 | 2-8°C |
| 용해도 | H2O: >10mg/mL |
| 물리적 상태 | 고체 |
| 색상 | 밝은 갈색에서 갈색까지 |
| 용해도 | H2O: >10mg/mL |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C22H30N2.ClH/c1-3-23(4-2)15-10-16-24(21-13-6-5-7-14-21)22-17-19-11-8-9-12-20(19)18-22/h5-9,11-14,22H,3-4,10,15-18H2,1-2H31H |
| InChIKey | KIPFVRHNAAZJOD-UHFFFAOYSA-N |
| SMILES | C1(CC2C=CC=CC=2C1)N(CCCN(CC)CC)C1C=CC=CC=1.Cl |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | TX7386000 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Aprindine is a long-acting antiarrhythmic agent, effective when administered orally or intravenously in the treatment of ventricular arrhythmias of varying etiologies.