Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(4-메틸피페라진-1-일)(4-니트로페닐)메탄온
(4-메틸피페라진-1-일)(4-니트로페닐)메탄온 · 1-Methyl-4-[(4-nitrophenyl)carbonyl]piperazine · (4-Methylpiperazin-1-yl)(4-nitrophenyl)Methanone · (4-methyl-1-piperazinyl)(4-nitrophenyl)methanone · Methanone, (4-methyl-1-piperazinyl)(4-nitrophenyl)-
식별자 및 물리적 특성
| CAS No. | 21091-98-5 |
|---|---|
| 분자식 | C12H15N3O3 |
| 평균 분자량 | 249.27 g/mol |
| 단동위원소 질량 | 249.11134134 g/mol |
| SMILES | CN1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChIKey | UMRXCSPRJVBXHH-UHFFFAOYSA-N |
| PubChem CID | 716396 |
| DTXSID | DTXSID70352008 |
| 현지명 | (4-메틸피페라진-1-일)(4-니트로페닐)메탄온 |
화학 및 물리적 성질
| XLogP | 0.2 |
|---|---|
| 극성 표면적 | 69.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 313 |
| 끓는 점 | 423.9±40.0 °C(Predicted) |
| 밀도 | 1.262±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 6.59±0.10(Predicted) |
안전 및 규제
| 관세 코드 | 2933399990 |
|---|
용도
용도
(4-Methylpiperazin-1-yl)(4-nitrophenyl)methanone is a useful reactant for interconversion of amide to thioamide using reusable MCM-41 mesoporous silica.