칼콘
칼콘 · (E)-CHALCONE · BENZALACETOPHENONE · CHALKONE · 1,3-DIPHENYL-2-PROPENONE · (E)-1,3-diphenylprop-2-en-1-one · Chalcone, 96% (Benzylidenacetophenon) · CHALCONE
식별자 및 물리적 특성
| CAS No. | 94-41-7 |
|---|---|
| 분자식 | C15H12O |
| 평균 분자량 | 208.25 g/mol |
| 단동위원소 질량 | 208.088815 g/mol |
| SMILES | O=C(C=Cc1ccccc1)c1ccccc1 |
| InChIKey | DQFBYFPFKXHELB-UHFFFAOYSA-N |
| PubChem CID | 7189 |
| ChEMBL | CHEMBL4777263 |
| DTXSID | DTXSID8022531 |
| 현지명 | 칼콘 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 242 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 3.62 |
| 녹는점 | 55-59 °C |
| 끓는 점 | 208 °C25 mm Hg(lit.) |
| 밀도 | d462 1.0712 |
| 굴절률 | nD62 1.6458 |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 디옥산: 용해성1g/10mL, 투명, 무색 |
| 물리적 상태 | 과립분말 |
| pKa(산도 계수) | -5.6 |
| 색상 | 노란색 |
| Merck | 14,2037 |
| BRN | 1210466 |
| InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H |
| InChIKey | DQFBYFPFKXHELB-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C=CC1=CC=CC=C1 |
| LogP(분배 계수) | 3.080 |
| EPA | 2-Propen-1-one, 1,3-diphenyl- (94-41-7) |
화학적 성질
light yellow powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | UD5576750 |
| 관세 코드 | 29143900 |
| 위험 문구(R) | 22-36/37 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-36/37/39-45 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Chalcone is the organic compound C6H5C(O)CH=CHC6H5. It is an α,β-unsaturated ketone. A variety of important biological compounds are known collectively as chalcones or chalconoids.They show antibacterial, antifungal, antitumor and anti-inflammatory properties. They are also intermediates in the biosynthesis of flavonoids, which are substances widespread in plants and with an array of biological activities. Chalcones are also intermediates in the Auwers synthesis of flavones.
용도
Chalcone is used in the preparation of pharmacologically-interesting heterocyclic systems like pyrazolines and pyrimidines. It also inhibits the proliferation of human breast cancer cell lines, MCF-7 and MDA-MB-231 by inducing apoptosis and blocking cell cycle progression in the G2/M phase.
제조 및 합성 방법
제조 방법
Chalcone is an aromatic ketone that forms the central core for a variety of important biological compounds, which are known collectively as chalcones.Chalcones can be prepared by an aldol condensation between a benzaldehyde and an acetophenone in the presence of sodium hydroxide as a catalyst.This reaction has been found to work without any solvent at all - a solid-state reaction. The reaction between substituted benzaldehydes and acetophenones has been used to demonstrate green chemistry in undergraduate chemistry education.In a study investigating green chemistry synthesis, chalcones were also synthesized from the same starting materials in high temperature water (200 to 350 °C).