Emiglitate
MKC-542 · BAY-o-1248 · Emiglitate · 1,5-dideoxy-1,5-[[2-[4-(ethoxycarbonyl)phenoxy]ethyl]imino]-D-glucitol · 1,5-dideoxy-1,5-[[2-[4-(ethoxycarbonyl)phenoxy]ethyl]imino]-D-glucitol USP/EP/BP · 4-[2-[(2R,3R,4R,5S)-3,4,5-Trihydroxy-2-(hydroxymethyl)piperidino]ethoxy]benzoic acid ethyl ester · Benzoic acid, 4-[2-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)-1-piperidinyl]ethoxy]-, ethyl ester
식별자 및 물리적 특성
| CAS No. | 80879-63-6 |
|---|---|
| 분자식 | C17H25NO7 |
| 평균 분자량 | 355.4 g/mol |
| 단동위원소 질량 | 355.16310214 g/mol |
| SMILES | CCOC(=O)c1ccc(OCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)cc1 |
| InChIKey | NWWORXYTJRPSMC-QKPAOTATSA-N |
| PubChem CID | 72004 |
| ChEMBL | CHEMBL2106304 |
| ChEBI | CHEBI:230574 |
| EC No. | 279-613-2 |
| DTXSID | DTXSID2048799 |
화학 및 물리적 성질
| XLogP | 0 |
|---|---|
| 극성 표면적 | 120 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 25 |
| 형식 전하 | 0 |
| 복잡도 | 414 |
| 의약품 | Pharmaceuticals -> Antibiotics |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 끓는 점 | 580.2±50.0 °C(Predicted) |
| 밀도 | 1.328±0.06 g/cm3(Predicted) |
| 저장 조건 | Store at -20°C |
| 용해도 | DMSO에 용해됨 |
| 물리적 상태 | Solid |
| pKa(산도 계수) | 13.68±0.70(Predicted) |
| 색상 | White to off-white |
용도
개요
Emiglitate (BAY O 1248), another deoxynojirimycin analogue is characterized by at least five-fold higher inhibitory potency than acarbose and additionally shows a long-lasting inhibitory effect. In animal studies emiglitate was still active up to 17 h after a single oral administration due to its pharmacokinetic behavior (formation of an active metabolite). Both miglitol and emiglitate differ in their pharmacokinetic behavior from acarbose, which is poorly absorbed (1 – 2 %). The deoxynojirimycin derivatives are structurally related to monosaccharides and will be absorbed in the jejunum.