Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 720596생성일: 2026년 11월 2일
Ethyl 2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate
ethyl 2-cyano-3-(3,4-dimethoxyphenyl)but-2-enoate · ETHYL 2-CYANO-3-(3,4-DIMETHOXYPHENYL)-2-BUTENOATE · 2-Butenoic acid, 2-cyano-3-(3,4-dimethoxyphenyl)-, ethyl ester
https://huagongshe.com/ko/chemical/720596
식별자 및 물리적 특성
| CAS No. | 15854-05-4 |
|---|
| 분자식 | C15H17NO4 |
|---|
| 평균 분자량 | 275.3 g/mol |
|---|
| 단동위원소 질량 | 275.11575802 g/mol |
|---|
| SMILES | CCOC(=O)/C(C#N)=C(\C)c1ccc(OC)c(OC)c1 |
|---|
| InChIKey | VRVDGLSITMUIHU-ZRDIBKRKSA-N |
|---|
| PubChem CID | 720596 |
|---|
| EC No. | 114-065-9 |
|---|
화학 및 물리적 성질
| XLogP | 3.1 |
|---|
| 극성 표면적 | 68.6 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 5 |
|---|
| 회전 가능 결합 수 | 6 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 421 |
|---|
| 끓는 점 | 403.8±45.0 °C(Predicted) |
|---|
| 밀도 | 1.126±0.06 g/cm3(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
