식별자 및 물리적 특성
| CAS No. | 292644-32-7 |
|---|
| 분자식 | C14H10ClNO4 |
|---|
| 평균 분자량 | 291.68 g/mol |
|---|
| 단동위원소 질량 | 291.0298355 g/mol |
|---|
| SMILES | O=Cc1cc(Cc2ccccc2Cl)cc([N+](=O)[O-])c1O |
|---|
| InChIKey | WWNPAYUIEZTOAI-UHFFFAOYSA-N |
|---|
| PubChem CID | 720992 |
|---|
| ChEMBL | CHEMBL2424783 |
|---|
| EC No. | 657-423-4 |
|---|
| DTXSID | DTXSID701201161 |
|---|
화학 및 물리적 성질
| XLogP | 4 |
|---|
| 극성 표면적 | 83.1 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 360 |
|---|
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P273, P280, P305+P351+P338, P337+P317, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
|---|
