Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에필갈로카테킨
에필갈로카테킨 · (-)-에피갈로카테킨 · EPIGALLOCATECHIN · epi- · l-Epigallocatechol · (-)-EGC, ≥98%(HPLC) · (-)-epigallocatechol · (+)-Epigallocatechin
식별자 및 물리적 특성
| CAS No. | 970-74-1 |
|---|---|
| 분자식 | C15H14O7 |
| 평균 분자량 | 306.27 g/mol |
| 단동위원소 질량 | 306.07395279 g/mol |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| PubChem CID | 72277 |
| ChEMBL | CHEMBL47386 |
| ChEBI | CHEBI:42255 |
| EC No. | 619-254-4 |
| DTXSID | DTXSID40891550 |
| 현지명 | 에필갈로카테킨 |
화학 및 물리적 성질
| XLogP | 0 |
|---|---|
| 극성 표면적 | 131 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 380 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 지질 | Polyketides [PK] -> Flavonoids [PK12] -> Flavans, Flavanols and Leucoanthocyanidins [PK1202] |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 219 - 221 °C208-210°C |
| Physical Description | Solid |
| Collision Cross Section | 165.5 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]152.21 Ų [M+H]+ [CCS Type: TW |
| 끓는 점 | 685.6±55.0 °C(Predicted) |
| 밀도 | 1.695±0.06 g/cm3(Predicted) |
| 저장 조건 | -20°C |
| 용해도 | 아세톤(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 9.02±0.15(Predicted) |
| 색상 | 흰색~밝은 베이지 |
| 생물학적 소스 | green tea |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 대사체학비타민, 기능성 식품 및 천연 제품 |
| InChI | 1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15-/m1/s1 |
| InChIKey | XMOCLSLCDHWDHP-IUODEOHRSA-N |
| SMILES | O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c3cc(O)c(O)c(O)c3 |
| LogP(분배 계수) | -0.100 (est) |
화학적 성질
white powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 75% (3 of 4) of all reports.WarningH315 (25%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (25%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | KB5100000 |
| 관세 코드 | 29329990 |
| 안전 문구(S) | 24/25 |
| F 고인화성물질 | 3-10 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
antineoplastic
일반 설명
()-Epigallocatechin (EGC) belongs to the tea catechins group of polyphenols.