Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
숙신산 디하이드라자이드
숙신산디하이드라자이드 · 부탄디히드라지드 · 377 · SUCCINIC DIHYDRAZIDE · Succinhydrazide · Succinohydrazide · AKOS BBS-00001037 · BUTANEDIHYDRAZIDE
식별자 및 물리적 특성
| CAS No. | 4146-43-4 |
|---|---|
| 분자식 | C4H10N4O2 |
| 평균 분자량 | 146.15 g/mol |
| 단동위원소 질량 | 146.08037556 g/mol |
| SMILES | NNC(=O)CCC(=O)NN |
| InChIKey | HCOMFAYPHBFMKU-UHFFFAOYSA-N |
| PubChem CID | 72491 |
| ChEMBL | CHEMBL3091861 |
| EC No. | 223-970-9 |
| DTXSID | DTXSID10194363 |
| 현지명 | 숙신산 디하이드라자이드 |
화학 및 물리적 성질
| XLogP | -2.8 |
|---|---|
| 극성 표면적 | 110 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 119 |
| 녹는점 | 170-171 °C (lit.) |
| 끓는 점 | 540.2±33.0 °C(Predicted) |
| 밀도 | 1.284±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 물에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 12.62±0.35(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| InChI | InChI=1S/C4H10N4O2/c5-7-3(9)1-2-4(10)8-6/h1-2,5-6H2,(H,7,9)(H,8,10) |
| InChIKey | HCOMFAYPHBFMKU-UHFFFAOYSA-N |
| SMILES | C(=O)(NN)CCC(=O)NN |
| NIST | Butanedioyl dihydrazide(4146-43-4) |
안전 및 규제
| GHS 분류 | WarningH302 (95.2%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.2%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | WM7500000 |
| 독성 | LD50 intraperitoneal in mouse: > 1gm/kg |
| 관세 코드 | 29280000 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 위험 등급 | IRRITANTAcute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Succinic dihydrazide (SDH) is an important organic compound used as aqueous coating auxiliary, epoxy cross-linking agent, deoxidiser, textile auxiliary, and biochemical reagent, mainly in laboratory organic synthesis processes and in research and development in chemical and pharmaceutical manufacturing. SDH has been shown to be a nitrogen atom donor for the preparation of nitride [M(N)]-complexes (M = 99mTc and 188Re)[1].