Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-페닐-1H-피라졸-5-탄수화물
3-페닐-1H-피라졸-5-탄수화물 · AKOS BBS-00004529 · 3-Phenyl-1H-pyrazole-5-carbohydrazide · 1H-Pyrazole-3-carboxylic acid, 5-phenyl-, hydrazide
식별자 및 물리적 특성
| CAS No. | 94033-64-4 |
|---|---|
| 분자식 | C10H10N4O |
| 평균 분자량 | 202.21 g/mol |
| SMILES | NNC(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChIKey | PZNLKKRMQOCPGG-UHFFFAOYSA-N |
| PubChem CID | 727014 |
| ChEMBL | CHEMBL5286970 |
| EC No. | 999-329-9 |
| 현지명 | 3-페닐-1H-피라졸-5-탄수화물 |
화학 및 물리적 성질
| XLogP | 0.7 |
|---|---|
| 극성 표면적 | 83.8 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| 녹는점 | 204-206 °C(Solv: water (7732-18-5)) |
| 밀도 | 1.314±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 11.50±0.10(Predicted) |
| 물리적 상태 | solid |
화학적 성질
White solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 관세 코드 | 29331990 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36 |