Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-페닐-4,5-디클로로-6-피리다존
1-페닐-4,5-디클로로-6-피리다존 · 1-Phenyl-4 · AKOS B029234 · AURORA KA-446 · OTAVA-BB BB0128630037 · 5-dichloro-6-pyridazone · 1-fenyl-4,5-dichlor-6-pyridazinon · 1-Phenyl-4,5-dichloro-6-pyridazine
식별자 및 물리적 특성
| CAS No. | 1698-53-9 |
|---|---|
| 분자식 | C10H6Cl2N2O |
| 평균 분자량 | 241.07 g/mol |
| 단동위원소 질량 | 239.98571817 g/mol |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccccc1 |
| InChIKey | VKWCOHVAHQOJGU-UHFFFAOYSA-N |
| PubChem CID | 72813 |
| ChEMBL | CHEMBL610198 |
| EC No. | 216-917-6 |
| DTXSID | DTXSID60168751 |
| 현지명 | 1-페닐-4,5-디클로로-6-피리다존 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 32.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 332 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 164-166 °C (lit.) |
| 끓는 점 | 307.0±52.0 °C(Predicted) |
| 밀도 | 1.4887 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | -3.44±0.60(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 라이트 베이지 |
| InChI | 1S/C10H6Cl2N2O/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7/h1-6H |
| InChIKey | VKWCOHVAHQOJGU-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(=O)N(N=C1)c2ccccc2 |
화학적 성질
light beige crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | UR6200000 |
| 관세 코드 | 29339980 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
1-Phenyl-4,5-dichloro-6-pyridazone is part of a group of arylated pyridazin-3(2H)-one compounds that act as anti-cancer agents. 1-Phenyl-4,5-dichloro-6-pyridazone also has herbicidal activity.