Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
7-브로모벤즈[A]안트라센
7-브로모벤즈[A]안트라센 · 7-Bromotetraphene · Bromobenzanthracene · 7-bromobenzanthracene · 7-BROMOBENZ[A]ANTHRACENE · 7-bromo-benz(a)anthracen · 10-brom-1,2-benzanthracen · 7-bromobenzo[a]anthracene
![7-브로모벤즈[A]안트라센 분자 구조식](/img/chemical/72849.png)
식별자 및 물리적 특성
| CAS No. | 32795-84-9 |
|---|---|
| 분자식 | C18H11Br |
| 평균 분자량 | 307.2 g/mol |
| 단동위원소 질량 | 306.00441 g/mol |
| SMILES | Brc1c2ccccc2cc2c1ccc1ccccc12 |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| PubChem CID | 72849 |
| EC No. | 621-169-2 |
| DTXSID | DTXSID70186461 |
| 현지명 | 7-브로모벤즈[A]안트라센 |
화학 및 물리적 성질
| XLogP | 6.4 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 326 |
| 녹는점 | 152 °C |
| 끓는 점 | 361.79°C (rough estimate) |
| 밀도 | 1.3995 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Room Temperature, under inert atmosphere |
| 용해도 | 클로로포름(약간), 디클로로메탄(약간)에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 연한 베이지부터 진한 노란색까지 |
| InChI | InChI=1S/C18H11Br/c19-18-15-8-4-2-6-13(15)11-17-14-7-3-1-5-12(14)9-10-16(17)18/h1-11H |
| InChIKey | LGRNWCDRODWMOH-UHFFFAOYSA-N |
| SMILES | C12=CC=CC=C1C=CC1C2=CC2C(=CC=CC=2)C=1Br |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| RTECS 번호 | CW0180000 |
| 관세 코드 | 2903.99.8001 |
용도
용도
7-Bromobenzo[A]anthracene is an organic synthesis intermediate, particularly used in the pharmaceutical and fine chemical industries to construct complex aromatic compounds.