N-(2-(((5-((Dimethylamino)methyl)furan-2-yl)methyl)sulfanyl)ethyl)-2-nitroacetamide
Ranitidine EP Impurity D (Ranitidine complex nitroacetamide) · N-[2-[[[5-[(Dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitroacetamide · Acetamide, N-[2-[[[5-[(dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitro- · N-[2-[[[5-[(dimethylamino)methyl]furan-2-yl]methyl]sulphanyl]ethyl]-2-nitroacetamide · Ranitidine Hydrochloride Impurity Ⅰ:N-(2-(((5-((dimethylamino)methyl)furan-2-yl)methyl)thio)ethyl)-2-nitroacetamide · Ranitidine EP Impurity DQ: What is Ranitidine EP Impurity D Q: What is the CAS Number of Ranitidine EP Impurity D Q: What is the storage condition of Ranitidine EP Impurity D Q: What are the applications of Ranitidine EP Impurity D
식별자 및 물리적 특성
| CAS No. | 117846-02-3 |
|---|---|
| 분자식 | C12H19N3O4S |
| 평균 분자량 | 301.36 g/mol |
| SMILES | CN(C)Cc1ccc(CSCCNC(=O)C[N+](=O)[O-])o1 |
| InChIKey | PFYRWZJFERNHFP-UHFFFAOYSA-N |
| PubChem CID | 72941663 |
화학 및 물리적 성질
| XLogP | 0.7 |
|---|---|
| 극성 표면적 | 117 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 322 |
| 끓는 점 | 476.9±45.0 °C(Predicted) |
| 밀도 | 1.235±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 6.06±0.29(Predicted) |
용도
용도
N-[2-[[[5-[(Dimethylamino)methyl]-2-furanyl]methyl]thio]ethyl]-2-nitroacetamide is an impurity compound of Ranitidine (R120000). Ranitidine is a histamine H2-receptor antagonist which inhibits gastric acid secretion. Antiulcerative.