Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 730366생성일: 2026년 11월 2일
2-((3,5-Dimethylanilino)carbonyl)benzoic acid
2-[(3,5-dimethylphenyl)carbamoyl]benzoic acid · 2-[(3,5-dimethylanilino)carbonyl]benzoic acid · 2-{[(3,5-dimethylphenyl)amino]carbonyl}benzoic acid · Benzoic acid, 2-[[(3,5-dimethylphenyl)amino]carbonyl]-
https://huagongshe.com/ko/chemical/730366
식별자 및 물리적 특성
| CAS No. | 69076-57-9 |
|---|
| 분자식 | C16H15NO3 |
|---|
| 평균 분자량 | 269.29 g/mol |
|---|
| 단동위원소 질량 | 269.10519334 g/mol |
|---|
| SMILES | Cc1cc(C)cc(NC(=O)c2ccccc2C(=O)O)c1 |
|---|
| InChIKey | FHJIPYNBUZLPGS-UHFFFAOYSA-N |
|---|
| PubChem CID | 730366 |
|---|
| EC No. | 665-179-5 |
|---|
| DTXSID | DTXSID10352623 |
|---|
화학 및 물리적 성질
| XLogP | 3 |
|---|
| 극성 표면적 | 66.4 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 20 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 359 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P351+P338, P330, P337+P317, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
