Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Hydrazinecarbothioamide, N-phenyl-
4-PHENYLTHIOSEMICARBAZIDE · N-Phenylhydrazinecarbothioamide · usafek-5426 · AKOS B001502 · WLN: ZMYUS&MR · 4-Phenylthiosemica · TIMTEC-BB SBB007538 · 4-PHENYL-3-THIOSEMIC
식별자 및 물리적 특성
| CAS No. | 5351-69-9 |
|---|---|
| 분자식 | C7H9N3S |
| 평균 분자량 | 167.23 g/mol |
| 단동위원소 질량 | 167.05171829 g/mol |
| SMILES | NNC(=S)Nc1ccccc1 |
| InChIKey | KKIGUVBJOHCXSP-UHFFFAOYSA-N |
| PubChem CID | 730679 |
| ChEMBL | CHEMBL4521724 |
| EC No. | 226-329-1 |
| DTXSID | DTXSID6063808 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 82.2 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 132 |
| 녹는점 | 138-140 °C (lit.) |
| 끓는 점 | 287.4±23.0 °C(Predicted) |
| 밀도 | 1.1960 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 메탄올: 50mg/mL, 투명 |
| pKa(산도 계수) | 11.01±0.70(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 608285 |
| InChI | InChI=1S/C7H9N3S/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,8H2,(H2,9,10,11) |
| InChIKey | KKIGUVBJOHCXSP-UHFFFAOYSA-N |
| SMILES | N(C(NC1=CC=CC=C1)=S)N |
| EPA | Hydrazinecarbothioamide, N-phenyl- (5351-69-9) |
화학적 성질
white to slightly yellow fine crystalline powder
안전 및 규제
| GHS 분류 | DangerH300 (93.5%): Fatal if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Hydrazinecarbothioamide, N-phenyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 2 (93.5%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | VT4025000 |
| 운송 번호(UN) | UN 2811 6.1/PG 2 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 25 |
| 위험 표시 | T,Xi |
| 안전 문구(S) | 45 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 2 Oral |
| 위험 참고 사항 | Harmful |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
4-Phenylthiosemicarbazide was used in the synthesis of amberlite XAD resins. It was also used in the synthesis of a series of thiosemicarbazones.