Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-3-니트로 안식향산
4-클로로-3-나이트로벤조산 · 4-클로로-3-니트로안식향산 · 4-클로로-3-니트로벤조산 · 4-Chloro-3-nitrobenzoic · BENZOIC ACID, 4-CHLORO-3-NITRO- · RARECHEM AL BO 0284 · TIMTEC-BB SBB000404 · Intedanib Impurity 1
식별자 및 물리적 특성
| CAS No. | 96-99-1 |
|---|---|
| 분자식 | C7H4ClNO4 |
| 평균 분자량 | 201.56 g/mol |
| 단동위원소 질량 | 200.98288529 g/mol |
| SMILES | O=C(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChIKey | DFXQXFGFOLXAPO-UHFFFAOYSA-N |
| PubChem CID | 7320 |
| ChEMBL | CHEMBL2260699 |
| EC No. | 202-550-9 |
| DTXSID | DTXSID7059143 |
| 현지명 | 4-클로로-3-니트로 안식향산 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| SpringerMaterials Properties | Crystal structure |
| 녹는점 | 180-183 °C (lit.) |
| 끓는 점 | 371.6±27.0 °C(Predicted) |
| 밀도 | 1.64 |
| 굴절률 | 1.6280 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 3.35±0.10(Predicted) |
| 색상 | 연한 노란색에서 크림색 |
| 용해도 | 342.7mg/L(온도 미표시) |
| BRN | 783626 |
| 헨리 상수 | 3.6×103 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| InChI | InChI=1S/C7H4ClNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11) |
| InChIKey | DFXQXFGFOLXAPO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 |
| NIST | Benzoic acid, 4-chloro-3-nitro-(96-99-1) |
| EPA | Benzoic acid, 4-chloro-3-nitro- (96-99-1) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzoic acid, 4-chloro-3-nitro-Status: Active Update: 20-04-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/58404-Chloro-3-nitrobenzoic acid: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DG5425050 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-24/25-36 |
| 기존화학 물질 | KE-05782 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Chloro-3-nitrobenzoic acid is commonly used as a chemical intermediate in pharmaceutical, dye, and agricultural syntheses.