Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(-)-Pinostrobin
Pistrobin · Pinostobin · PINOSTROBIN · Pinostrombin · loteprednol Impurity 18 · Pinostrobin, 10 mM in DMSO · 5-Hydroxy-7-methoxyflavanone · 5-Hydroxy-7-methoxy-2-phenyl-chroman-4-one
식별자 및 물리적 특성
| CAS No. | 480-37-5 |
|---|---|
| 분자식 | C16H14O4 |
| 평균 분자량 | 270.28 g/mol |
| SMILES | COc1cc(O)c2c(c1)O[C@H](c1ccccc1)CC2=O |
| InChIKey | ORJDDOBAOGKRJV-AWEZNQCLSA-N |
| PubChem CID | 73201 |
| ChEMBL | CHEMBL254613 |
| ChEBI | CHEBI:80491 |
| EC No. | 207-548-1 |
| DTXSID | DTXSID50963979 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 55.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 350 |
| 지질 | Polyketides [PK] -> Flavonoids [PK12] -> Flavanones [PK1214] |
| Collision Cross Section | 164.24 Ų [M+H]+ [CCS Type: DTMethod: stepped-field] |
| 녹는점 | 100°C |
| 끓는 점 | 494.9±45.0 °C(Predicted) |
| 밀도 | 1.284±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 용해도 | DMF: 20 mg/mlDMF:PBS (pH 7.2)(1:3): 0.25 mg/mlDMSO: 12 mg/ml |
| 물리적 상태 | 결정성 고체 |
| pKa(산도 계수) | 7.40±0.40(Predicted) |
| 색상 | White to yellow |
| InChI | InChI=1S/C16H14O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-8,14,17H,9H2,1H3/t14-/m0/s1 |
| InChIKey | ORJDDOBAOGKRJV-AWEZNQCLSA-N |
| SMILES | [C@H]1(C2=CC=CC=C2)OC2=CC(OC)=CC(O)=C2C(=O)C1 |
| LogP(분배 계수) | 3.591 (est) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
용도
개요
Pinostrobin is a flavonoid with diverse biological activities, including antioxidant, anti-inflammatory, and anticancer properties. It induces quinone reductase (QR) in murine hepatoma cells with a QR doubling concentration of 500 nM. Pinostrobin inhibits TNF-α and IL-1β production in RAW 264.7 macrophages (IC50s = 17.28 and 23.5 μM, respectively) and in LPS-stimulated rats (48.6 and 55% reduction, respectively). Pinostrobin also shows selective cytotoxicity for CCRF-CEM leukemia cells (IC50 = 10.2 μM) in a panel of eight cancer cell lines (IC50s = >30 μM).