Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 732239생성일: 2026년 11월 4일
2-[[Benzyl(methyl)amino]methyl]isoindole-1,3-dione
2-((BENZYL-METHYL-AMINO)-METHYL)-ISOINDOLE-1,3-DIONE · 2-{[benzyl(methyl)amino]methyl}-1H-isoindole-1,3(2H)-dione · 1H-Isoindole-1,3(2H)-dione, 2-[[methyl(phenylmethyl)amino]methyl]-
https://huagongshe.com/ko/chemical/732239
식별자 및 물리적 특성
| CAS No. | 57675-92-0 |
|---|
| 분자식 | C17H16N2O2 |
|---|
| 평균 분자량 | 280.32 g/mol |
|---|
| 단동위원소 질량 | 280.12117776 g/mol |
|---|
| SMILES | CN(Cc1ccccc1)CN1C(=O)c2ccccc2C1=O |
|---|
| InChIKey | QDTLCDRPBBCDMJ-UHFFFAOYSA-N |
|---|
| PubChem CID | 732239 |
|---|
| EC No. | 141-261-1 |
|---|
화학 및 물리적 성질
| XLogP | 3.1 |
|---|
| 극성 표면적 | 40.6 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 21 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 380 |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P273, P301+P317, P330, P391, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
![2-[[Benzyl(methyl)amino]methyl]isoindole-1,3-dione 분자 구조식](/img/chemical/732239.png)