Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
o-Chloranil
O-CHLORANIL · 2-chloranil · 3,4,5,6-TETRACHLORO-1,2-BENZOQUINONE · 3,4,5,6-Tetrachlorocyclohexa-3,5-diene-1,2-dione · Isochloranil · o-Chloroanil · ortho-Chloranil · o-Chloranil,98%
식별자 및 물리적 특성
| CAS No. | 2435-53-2 |
|---|---|
| 분자식 | C6Cl4O2 |
| 평균 분자량 | 245.9 g/mol |
| 단동위원소 질량 | 243.86523996 g/mol |
| SMILES | O=C1C(=O)C(Cl)=C(Cl)C(Cl)=C1Cl |
| InChIKey | VRGCYEIGVVTZCC-UHFFFAOYSA-N |
| PubChem CID | 73252 |
| ChEMBL | CHEMBL364729 |
| EC No. | 219-424-4 |
| DTXSID | DTXSID90883844 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 34.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 305 |
| SpringerMaterials Properties | Schoenflies notation |
| 녹는점 | 126-129 °C(lit.) |
| 끓는 점 | 164.7±40.0 °C(Predicted) |
| 밀도 | 1.7462 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | almost transparency in Methanol |
| 물리적 상태 | 미세 결정성 분말 |
| 색상 | 진한 붉은색 |
| 용해도 | 불용성 |
| BRN | 1309782 |
| InChI | 1S/C6Cl4O2/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | VRGCYEIGVVTZCC-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(=O)C(=O)C(Cl)=C1Cl |
| NIST | 3,5-Cyclohexadiene-1,2-dione, 3,4,5,6-tetrachloro-(2435-53-2) |
| EPA | o-Chloranil (2435-53-2) |
화학적 성질
bordeaux fine crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (97.6%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (97.6%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | 2811 |
| 관세 코드 | 29147090 |
| 위험 문구(R) | 36/37/38-50/53-36/38-20 |
| 위험 표시 | Xi,N,Xn |
| 안전 문구(S) | 26-36-61-60-37-22 |
| 포장분류 | III |
| 위험 등급 | 8Aquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Skin Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
o-Chloranil is used as a reagent in the synthesis of fused triazolotriazines and triazolotriazepines which exhibit antibacterial activity. Also used as a reagent in the synthesis of nickel diimine catecholate charge-transfer complexes.