Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-아세틸-4-부티르아미도페놀
2-아세틸-4-부티르아미도페놀 · LABOTEST-BB LT01143417 · Acebutolol EP IMpurity C · Acebutolol impurity C CRS · Acebuprolol EP Impurity C · 2-ACETYL-4-BUTYRAMIDOPHENOL · 2-Acetyl-4-Butyramidephenol · Acebutolol Related CoMpound A
식별자 및 물리적 특성
| CAS No. | 40188-45-2 |
|---|---|
| 분자식 | C12H15NO3 |
| 평균 분자량 | 221.25 g/mol |
| 단동위원소 질량 | 221.10519334 g/mol |
| SMILES | CCCC(=O)Nc1ccc(O)c(C(C)=O)c1 |
| InChIKey | FGWZEOPEZISTTR-UHFFFAOYSA-N |
| PubChem CID | 736331 |
| ChEMBL | CHEMBL3184751 |
| EC No. | 254-831-0 |
| DTXSID | DTXSID7057737 |
| 현지명 | 2-아세틸-4-부티르아미도페놀 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 66.4 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 265 |
| 녹는점 | 120-126 °C (lit.) |
| 끓는 점 | 428.0±35.0 °C(Predicted) |
| 밀도 | 1.192±0.06 g/cm3(Predicted) |
| 저장 조건 | Refrigerator |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | solid |
| pKa(산도 계수) | 10.37±0.31(Predicted) |
| 색상 | 페일베이지 |
| InChI | InChI=1S/C12H15NO3/c1-3-4-12(16)13-9-5-6-11(15)10(7-9)8(2)14/h5-7,15H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | FGWZEOPEZISTTR-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=C(O)C(C(C)=O)=C1)(=O)CCC |
안전 및 규제
| GHS 분류 | WarningH315 (98%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 98 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | REACH registered substance: N-(3-acetyl-4-hydroxyphenyl)butyramide (EC: 254-831-0) |
| Hazard Classes and Categories | Skin Irrit. 2 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2924296000 |
| 위험 문구(R) | 38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36/37 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Acebutolol (A123800)