Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(4-Bromophenyl)propan-2-one
1-(4-BROMOPHENYL)PROPAN-2-ONE · 4-BROMOPHENYLACETONE · 4-BROMOPHENYLACETONATE · LABOTEST-BB LT01143429 · 4-Bromophenylacetone,97% · 4-Bromophenylacetone,99% · 4-Bromophenylacetone >4-Bromophenylacetone ,98% · P-BROMO BENZYL METHYL KETONE
식별자 및 물리적 특성
| CAS No. | 6186-22-7 |
|---|---|
| 분자식 | C9H9BrO |
| 평균 분자량 | 213.07 g/mol |
| 단동위원소 질량 | 211.98367701 g/mol |
| SMILES | CC(=O)Cc1ccc(Br)cc1 |
| InChIKey | CFMMTXJMIJRUSH-UHFFFAOYSA-N |
| PubChem CID | 736332 |
| EC No. | 976-149-9 |
| DTXSID | DTXSID60352996 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 136 |
| 녹는점 | 24-25 °C |
| 끓는 점 | 139°C/11mmHg(lit.) |
| 밀도 | 1.3841 (rough estimate) |
| 굴절률 | 1.5560 to 1.5600 |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 녹은 후에 액체 |
| 색상 | 맑은 노란색 |
| 용해도 | 클로로포름 및 디클로로메탄과 혼합 가능. 물과 약간 섞임. |
| InChI | InChI=1S/C9H9BrO/c1-7(11)6-8-2-4-9(10)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | CFMMTXJMIJRUSH-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(Br)C=C1)C(=O)C |
화학적 성질
clear light yellow liquid after melting
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 29143900 |
| 안전 문구(S) | 24/25 |
용도
용도
4-Bromophenylacetone is used to prepare biphenyl-4-yl-acetone by reacting with phenylboronic acid using cesium fluoride as a reagent and palladium phosphine complex as a catalyst.