Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Aminothiophene-3-carbonitrile
2-AMINOTHIOPHENE-3-CARBONITRILE · AKOS 92285 · AKOS B014697 · Compound Fr16663 · AKOS BBS-00006621 · BUTTPARK 36\18-34 · ART-CHEM-BB B014697 · TIMTEC-BB SBB005484
식별자 및 물리적 특성
| CAS No. | 4651-82-5 |
|---|---|
| 분자식 | C5H4N2S |
| 평균 분자량 | 124.17 g/mol |
| 단동위원소 질량 | 124.00951913 g/mol |
| SMILES | N#Cc1ccsc1N |
| InChIKey | XVGHZFWFGXDIOU-UHFFFAOYSA-N |
| PubChem CID | 736607 |
| ChEMBL | CHEMBL5218826 |
| EC No. | 610-308-2 |
| DTXSID | DTXSID90353072 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 78.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 126 |
| 녹는점 | 104-108 °C |
| 끓는 점 | 318℃ |
| 밀도 | 1.33 |
| 인화점 | 146℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 물리적 상태 | powder to crystalline |
| pKa(산도 계수) | -0.28±0.10(Predicted) |
| 색상 | White to Light yellow to Light orange |
| InChI | InChI=1S/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| InChIKey | XVGHZFWFGXDIOU-UHFFFAOYSA-N |
| SMILES | C1(N)SC=CC=1C#N |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | DangerH302 (95.6%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (95.6%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 3439 |
| 관세 코드 | 2934999090 |
| 위험 문구(R) | 20/21/22-36/37/38-41-37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 36/37-39-26 |
| 위험 등급 | IRRITANTAcute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |