Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(Trifluoromethoxy)aniline
3-(Trifluoromethoxy)benzenamine · uoromethoxy)aniL · BUTTPARK 44\03-14 · TIMTEC-BB SBB006603 · 3-(Trifluormethoxy)anilin · M-(TRIFLUOROMETHOXY)ANILINE · 3-(TRIFLUOROMETHOXY)ANILINE · α,α,α-Trifluoro-m-anisidine
식별자 및 물리적 특성
| CAS No. | 1535-73-5 |
|---|---|
| 분자식 | C7H6F3NO |
| 평균 분자량 | 177.12 g/mol |
| 단동위원소 질량 | 177.04014847 g/mol |
| SMILES | Nc1cccc(OC(F)(F)F)c1 |
| InChIKey | SADHVOSOZBAAGL-UHFFFAOYSA-N |
| PubChem CID | 73753 |
| EC No. | 216-256-3 |
| DTXSID | DTXSID60165341 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 35.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 148 |
| SpringerMaterials Properties | Chemical shift |
| 끓는 점 | 72-73 °C8 mm Hg(lit.) |
| 밀도 | 1.325 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.466(lit.) |
| 인화점 | 185 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 클로로포름(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 3.36±0.10(Predicted) |
| 비중 | 1.325 |
| 색상 | 맑은 노란색에서 주황색으로 |
| 용해도 | 물에 섞이거나 혼합하기 어렵지 않습니다. |
| BRN | 776921 |
| InChI | InChI=1S/C7H6F3NO/c8-7(9,10)12-6-3-1-2-5(11)4-6/h1-4H,11H2 |
| InChIKey | SADHVOSOZBAAGL-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(OC(F)(F)F)=C1 |
화학적 성질
CLEAR YELLOW LIQUID
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 29222900 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 26-27-36/37/39-36 |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
3-(Trifluoromethoxy)aniline is reactant in the synthesis of pyrazolone-quinazolone hybrids as human hydroxyphenylpyruvate dioxygenase inhibitors which is a potential treatment for type I tyrosinemia.
일반 설명
Synthesis of 3-(trifluoromethoxy)aniline from 2-chlorophenol has been reported.