Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-벤질록시벤조산
4-벤질록시벤조산 · BRL 14280 · NSC 16633 · AKOS BBB/285 · AKOS BB-8602 · ASISCHEM A95731 · VITAS-BB TBB000342 · ART-CHEM-BB B025595
식별자 및 물리적 특성
| CAS No. | 1486-51-7 |
|---|---|
| 분자식 | C14H12O3 |
| 평균 분자량 | 228.24 g/mol |
| 단동위원소 질량 | 228.07864424 g/mol |
| SMILES | O=C(O)c1ccc(OCc2ccccc2)cc1 |
| InChIKey | AQSCHALQLXXKKC-UHFFFAOYSA-N |
| PubChem CID | 73880 |
| ChEMBL | CHEMBL3134411 |
| ChEBI | CHEBI:194624 |
| EC No. | 216-066-0 |
| DTXSID | DTXSID00164030 |
| 현지명 | 4-벤질록시벤조산 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 46.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 238 |
| 녹는점 | 189-192 °C(lit.) |
| 끓는 점 | 396.3±17.0 °C(Predicted) |
| 밀도 | 1.222 |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | very faint turbidity in Pyridine |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 4.46±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 2111640 |
| InChI | InChI=1S/C14H12O3/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,15,16) |
| InChIKey | AQSCHALQLXXKKC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OCC2=CC=CC=C2)C=C1 |
안전 및 규제
| GHS 분류 | WarningH302 (83.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (83.3%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29189900 |
| 위험 문구(R) | 22-36 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Benzyloxybenzoic acid may be used in the preparation of 1,3-phenylene bis(4-benzyloxybenzoate). It may also be used in the preparation of (-)-(2R,3R)-5,7-bis(benzyloxy)-2-[3,4,5-tris(benzyloxy)-phenyl]chroman-3-yl-(4-benzyloxy)benzoate.
일반 설명
4-Benzyloxybenzoic acid is a substituted benzoic acid that can be prepared by the benzylation of 4-hydroxybenzoic acid with benzyl bromide.