Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-브로모벤젠술포닐클로라이드
4-브로모벤젠술포닐클로라이드 · 4-bromobenzene-1-sulfonyl chloride · P-BROMOBENZENESULFONYL CHLORIDE · 4-BromobenzenesuL · p-Brosyl chloride · AKOS BBS-00004603 · 4-Bromobenzenesulfon · 4-Bromo-Benzenesulfonyl
식별자 및 물리적 특성
| CAS No. | 98-58-8 |
|---|---|
| 분자식 | C6H4BrClO2S |
| 평균 분자량 | 255.52 g/mol |
| 단동위원소 질량 | 253.88039015 g/mol |
| SMILES | O=S(=O)(Cl)c1ccc(Br)cc1 |
| InChIKey | KMMHZIBWCXYAAH-UHFFFAOYSA-N |
| PubChem CID | 7396 |
| EC No. | 202-683-2 |
| DTXSID | DTXSID9059173 |
| 현지명 | 4-브로모벤젠술포닐클로라이드 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 213 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 73-75 °C (lit.) |
| 끓는 점 | 153 °C/15 mmHg (lit.) |
| 밀도 | 1.7910 (estimate) |
| 인화점 | 152-154°C/26mm |
| 저장 조건 | Refrigerator, Under Inert Atmosphere |
| 용해도 | soluble in Chloroform, DMSO |
| 물리적 상태 | 결정 또는 결정성 분말 |
| 색상 | 흰색에서 베이지색 |
| 용해도 | 물에서 분해되다 |
| Merck | 14,1407 |
| BRN | 743518 |
| InChI | InChI=1S/C6H4BrClO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H |
| InChIKey | KMMHZIBWCXYAAH-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(Br)C=C1 |
| EPA | Benzenesulfonyl chloride, 4-bromo- (98-58-8) |
화학적 성질
white to beige crystals or crystalline powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 3.8% (2 of 52) of reports.DangerH314 (96.2%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 17-05-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/334934-Bromobenzenesulphonyl chloride: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Corr. 1C (96.2%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049020 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-27 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
4-Bromobenzenesulfonyl chloride is used for identification of amines, and also in the synthesis and inhibition studies of substituted N-L-histidinylphenylsulfonyl hydrazide.