Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-브로모-4-플로로톨루엔
2-브로모-4-플로로-1-메틸벤젠 · 2-브로모-4-플로로톨루엔 · 2-브로모-4-플루오로톨루엔 · 2-BROMO-4-FLUORO-1-METHYLBENZENE · 2-Bromo-4-fluorotolu · CL027 · 2-Brom-4-fluortoluol · 2-Bromo-4-flurotoluene
식별자 및 물리적 특성
| CAS No. | 1422-53-3 |
|---|---|
| 분자식 | C7H6BrF |
| 평균 분자량 | 189.02 g/mol |
| 단동위원소 질량 | 187.96369051 g/mol |
| SMILES | Cc1ccc(F)cc1Br |
| InChIKey | SFGFOJPGCOYQJK-UHFFFAOYSA-N |
| PubChem CID | 74016 |
| EC No. | 215-830-0 |
| DTXSID | DTXSID70161970 |
| 현지명 | 2-브로모-4-플로로톨루엔 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 94.9 |
| 끓는 점 | 170-172 °C (lit.) |
| 밀도 | 1.526 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.528(lit.) |
| 인화점 | 148 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 액체 |
| 색상 | Clear, faint yellow/faint green |
| 비중 | 1.526 |
| BRN | 1859038 |
| InChI | InChI=1S/C7H6BrF/c1-5-2-3-6(9)4-7(5)8/h2-4H,1H3 |
| InChIKey | SFGFOJPGCOYQJK-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C(F)C=C1Br |
| NIST | 2-Bromo-4-fluorotoluene(1422-53-3) |
화학적 성질
colorless to light yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2810 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2-Bromo-4-fluorotoluene may be used in the preparation of meta-fluoro analog, (tris(5-fluoro-2-methylphenyl)phosphane, F-TOTP).