Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,2-디플루오르-1,3-벤조다이옥솔
2,2-디플루오르-1,3-벤조다이옥솔 · 2,2-디플루오로-1,3-벤조디옥솔 · 2,2-difluorobenzo[d][1,3]dioxole · 2,2-Difluoro-2H-1,3-benzodioxole · 2,2-Difluoro-1,3-ben · uoro-1,3-benzodioxoL · 2,2-Difluorochalcone · LABOTEST-BB LT01148491
식별자 및 물리적 특성
| CAS No. | 1583-59-1 |
|---|---|
| 분자식 | C7H4F2O2 |
| 평균 분자량 | 158.1 g/mol |
| 단동위원소 질량 | 158.01793581 g/mol |
| SMILES | FC1(F)Oc2ccccc2O1 |
| InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
| PubChem CID | 74103 |
| EC No. | 216-431-4 |
| DTXSID | DTXSID60166398 |
| 현지명 | 2,2-디플루오르-1,3-벤조다이옥솔 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 18.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 145 |
| PFAS | PFAS -> PFAS identified in REACH Regulation EC No. 1272/2008 |
| 끓는 점 | 129-130°C |
| 밀도 | 1,308 g/cm3 |
| 굴절률 | 1.443 |
| 인화점 | 129-130°C |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| 물리적 상태 | 기름 |
| 색상 | 투명 무색 |
| BRN | 1307648 |
| InChI | InChI=1S/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
| InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OC1(F)F |
| LogP(분배 계수) | 2.96 |
화학적 성질
Colorless to pale yellow liquid
안전 및 규제
| GHS 분류 | WarningH226 (67.2%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P272, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P333+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 116 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 07-03-2016 https://echa.europa.eu/registration-dossier/-/registered-dossier/11884 |
| Hazard Classes and Categories | Flam. Liq. 3 (67.2%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN1993 |
| 관세 코드 | 2932990090 |
| 위험 문구(R) | 36/37/38-43 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36/37/39-36/37 |
| 포장분류 | III |
| 위험 등급 | 3Flam. Liq. 3Skin Irrit. 2Skin Sens. 1 |
| 기존화학 물질 | 2014-3-5941 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2,2-Difluoro-1,3-benzodioxole is used in the synthesis of Kv3 inhibitors as well as in the preparation of renin inhibitors.