Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-Methylpicolinonitrile
5-Methylpicolinonitrile · 6-Cyano-3-picoline · 5-Methypicolinonitrile · -pyridine-2-carbonitriL · 5-Methyl-2-cyanopyridine · 2-CYANO-5-METHYLPYRIDINE · 2-Cyano-5-methylpyridine >2-Cyano-5-methylpyridine ,97% · 5-Methylpyridin-2-carbonitrile
식별자 및 물리적 특성
| CAS No. | 1620-77-5 |
|---|---|
| 분자식 | C7H6N2 |
| 평균 분자량 | 118.14 g/mol |
| 단동위원소 질량 | 118.05309819 g/mol |
| SMILES | Cc1ccc(C#N)nc1 |
| InChIKey | LIEQVZZZYLHNRH-UHFFFAOYSA-N |
| PubChem CID | 74183 |
| EC No. | 216-589-4 |
| DTXSID | DTXSID20167285 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 36.7 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 133 |
| 녹는점 | 73-75°C |
| 끓는 점 | 140°C/20mmHg(lit.) |
| 밀도 | 1.08±0.1 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -0.03±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| InChI | InChI=1S/C7H6N2/c1-6-2-3-7(4-8)9-5-6/h2-3,5H,1H3 |
| InChIKey | LIEQVZZZYLHNRH-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(C)C=C1 |
화학적 성질
Light yellow Cryst
안전 및 규제
| GHS 분류 | DangerH301 (20%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (20%) |
| 운송 번호(UN) | 3439 |
| 관세 코드 | 2933399990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 포장분류 | Ⅲ |
| 위험 등급 | 6.1 |
용도
용도
2-Cyano-5-methylpyridine (5-methylpicolinonitrile) is a methylpyridine analogue mainly used as a raw material or intermediate component in organic synthesis. It is used in the synthesis of 5-Methylpicolinaldehyde and its derivatives.