Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Benzenesulfonyl chloride, 2,4-dinitro-
2,4-DinitrobenzenesuL · 2,4-Dinitrobenzenesulfonylchl · 4-Dinitrobenzenesulfonyl chloride · 2,4-Dinitrophenylsulfonyl chloride · 2,4-dinitro-benzenesulfonylchlorid · 2,4-DINITROBENZENESULFONYL CHLORIDE · 2,4-DINITROBENZENESULPHONYL CHLORIDE · Benzenesulfonyl chloride, 2,4-dinitro-
식별자 및 물리적 특성
| CAS No. | 1656-44-6 |
|---|---|
| 분자식 | C6H3ClN2O6S |
| 평균 분자량 | 266.62 g/mol |
| 단동위원소 질량 | 265.9400345 g/mol |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Cl)c([N+](=O)[O-])c1 |
| InChIKey | SSFSNKZUKDBPIT-UHFFFAOYSA-N |
| PubChem CID | 74255 |
| EC No. | 216-749-3 |
| DTXSID | DTXSID2061854 |
화학 및 물리적 성질
| XLogP | 1.7 |
|---|---|
| 극성 표면적 | 134 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 393 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 101-103 °C (lit.) |
| 끓는 점 | 60-80 °C |
| 밀도 | 1.780 |
| 저장 조건 | -20°C Freezer |
| 용해도 | 클로로포름(약간 용해됨) |
| 물리적 상태 | 고체 |
| 색상 | 밝은 노란색 결정 |
| 용해도 | 물과 반응합니다. |
| BRN | 2147583 |
| 안정성 | 흡습성 |
| InChI | 1S/C6H3ClN2O6S/c7-16(14,15)6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| InChIKey | SSFSNKZUKDBPIT-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(c(c1)[N+]([O-])=O)S(Cl)(=O)=O |
| EPA | Benzenesulfonyl chloride, 2,4-dinitro- (1656-44-6) |
화학적 성질
yellow crystalline powder
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Benzenesulfonyl chloride, 2,4-dinitro-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 2904990090 |
| 위험 문구(R) | 34-65-48/23/24/25-46-45-48/20/21/22 |
| 위험 표시 | T,C |
| 안전 문구(S) | 53-26-36/37/39-45-62 |
| 포장분류 | II |
| 위험 등급 | 8Carc. 1AEye Dam. 1Muta. 1BSkin Corr. 1BSTOT RE 2 |
| F 고인화성물질 | 21 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
2,4-Dinitrobenzenesulfonyl chloride was used to protect primary amines. It was used as starting reagent in the synthesis of tert-butyl 2-[(2,4-dinitrophenyl) sulfonyl]amino acetate.
일반 설명
2,4-Dinitrobenzenesulfonyl chloride causes the sulfonation of glycosylamines to yield N-glycosyl-2,4-dinitrobenzenesulfonamides.