Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-디브로모-4-니트로페놀
2,6-디브로모-4-니트로페놀 · 2,6-Dibromo-4-nit · 2,6-DibroMo-4-nitrop · 2,6-Dibromo-4-mitrophenol · 2,6-DIBROMO-4-NITROPHENOL · 4-Nitro-2,6-dibromophenol · 2,6-dibromo-4-nitro-pheno · Benzbromarone Impurity 16
식별자 및 물리적 특성
| CAS No. | 99-28-5 |
|---|---|
| 분자식 | C6H3Br2NO3 |
| 평균 분자량 | 296.9 g/mol |
| 단동위원소 질량 | 294.84797 g/mol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(Br)c1 |
| InChIKey | WBHYZUAQCSHXCT-UHFFFAOYSA-N |
| PubChem CID | 7429 |
| EC No. | 202-744-3 |
| DTXSID | DTXSID7059191 |
| 현지명 | 2,6-디브로모-4-니트로페놀 |
화학 및 물리적 성질
| XLogP | 3.6 |
|---|---|
| 극성 표면적 | 66.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 172 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| LogP(분배 계수) | 3.07 |
| 녹는점 | 145 °C (dec.)(lit.) |
| 끓는 점 | 297.8±40.0 °C(Predicted) |
| 밀도 | 2.3436 (rough estimate) |
| 굴절률 | 1.6220 (estimate) |
| 저장 조건 | 2-8°C(protect from light) |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 3.67±0.44(Predicted) |
| 색상 | White to Orange to Green |
| BRN | 1245050 |
| InChI | InChI=1S/C6H3Br2NO3/c7-4-1-3(9(11)12)2-5(8)6(4)10/h1-2,10H |
| InChIKey | WBHYZUAQCSHXCT-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Br)C=C([N+]([O-])=O)C=C1Br |
| NIST | 2,6-Dibromo-4-nitrophenol(99-28-5) |
| EPA | 2,6-Dibromo-4-nitrophenol (99-28-5) |
화학적 성질
yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (87.2%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | T - indicates a substance that is the subject of a final TSCA section 4 test rule. |
| Hazard Classes and Categories | Acute Tox. 4 (87.2%) |
| Protective Action Criteria (PAC) | 0.18 [mg/m3]2.0 [mg/m3]12 [mg/m3] |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | SK8025000 |
| 관세 코드 | 29089990 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,C |
| 안전 문구(S) | 26-36-37 |